The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[5-Methyl-6-(3-methyl-but-2-enyloxy)-9-oxo-9H-xanthen-4-yl]-acetic acid ID: ALA147547
PubChem CID: 44363897
Max Phase: Preclinical
Molecular Formula: C21H20O5
Molecular Weight: 352.39
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=CCOc1ccc2c(=O)c3cccc(CC(=O)O)c3oc2c1C
Standard InChI: InChI=1S/C21H20O5/c1-12(2)9-10-25-17-8-7-16-19(24)15-6-4-5-14(11-18(22)23)21(15)26-20(16)13(17)3/h4-9H,10-11H2,1-3H3,(H,22,23)
Standard InChI Key: KVNROQALSFXJDQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
0.1875 -1.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1875 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -2.3292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -0.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -1.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5250 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5208 -0.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2333 -1.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -3.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 0.1458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2375 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7417 -3.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0958 -1.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3833 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -0.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 -4.3917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9500 -2.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6625 -1.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5208 -3.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 -1.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0958 -1.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8083 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 2 1 0
5 3 1 0
6 5 2 0
7 1 1 0
8 5 1 0
9 2 1 0
10 12 1 0
11 7 2 0
12 8 1 0
13 4 2 0
14 11 1 0
15 10 2 0
16 17 2 0
17 21 1 0
18 6 1 0
19 10 1 0
20 11 1 0
21 20 1 0
22 7 1 0
23 8 2 0
24 23 1 0
25 16 1 0
26 16 1 0
14 9 2 0
4 6 1 0
18 24 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 352.39Molecular Weight (Monoisotopic): 352.1311AlogP: 4.23#Rotatable Bonds: 5Polar Surface Area: 76.74Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.23CX Basic pKa: ┄CX LogP: 4.31CX LogD: 0.87Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.55Np Likeness Score: 0.64
References 1. Gobbi S, Rampa A, Bisi A, Belluti F, Valenti P, Caputo A, Zampiron A, Carrara M.. (2002) Synthesis and antitumor activity of new derivatives of xanthen-9-one-4-acetic acid., 45 (22): [PMID:12383019 ] [10.1021/jm020929p ]