The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID4264567 ID: ALA1486010
Cas Number: 620928-72-5
PubChem CID: 2951279
Max Phase: Preclinical
Molecular Formula: C24H18N2O6
Molecular Weight: 430.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2cc(C(=O)C3=C(O)C(=O)N(Cc4ccco4)C3c3cccnc3)oc12
Standard InChI: InChI=1S/C24H18N2O6/c1-30-17-8-2-5-14-11-18(32-23(14)17)21(27)19-20(15-6-3-9-25-12-15)26(24(29)22(19)28)13-16-7-4-10-31-16/h2-12,20,28H,13H2,1H3
Standard InChI Key: QDRADAWVHBJQHB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
2.0083 -0.4597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0866 0.3953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4598 2.1509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2859 -0.5068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5074 -1.4423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5729 4.3583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0084 2.2279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7874 1.4058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2859 0.9222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6214 1.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5346 1.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7061 1.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6984 0.2077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5234 0.2077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4284 1.8474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7929 -0.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7929 0.6202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0946 3.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0083 0.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5074 -0.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9805 1.2343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6834 2.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5729 3.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5074 1.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2219 -0.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2219 0.6202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4903 2.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3575 3.2784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0424 2.1904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3575 4.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8424 3.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2219 -1.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 14 1 0
1 16 1 0
2 11 1 0
3 12 2 0
4 13 2 0
5 20 1 0
5 32 1 0
6 23 1 0
6 30 1 0
7 10 1 0
7 12 1 0
7 18 1 0
8 21 2 0
8 29 1 0
9 10 1 0
9 11 2 0
9 13 1 0
10 15 1 0
11 12 1 0
13 14 1 0
14 19 2 0
15 21 1 0
15 22 2 0
16 17 2 0
16 20 1 0
17 19 1 0
17 24 1 0
18 23 1 0
20 25 2 0
22 27 1 0
23 28 2 0
24 26 2 0
25 26 1 0
27 29 2 0
28 31 1 0
30 31 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.42Molecular Weight (Monoisotopic): 430.1165AlogP: 4.21#Rotatable Bonds: 6Polar Surface Area: 106.01Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.12CX Basic pKa: 4.75CX LogP: 1.74CX LogD: 1.73Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -1.19
References 1. PubChem BioAssay data set,