The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID860927 ID: ALA1486406
Cas Number: 536719-40-1
PubChem CID: 662200
Max Phase: Preclinical
Molecular Formula: C21H26ClN5O2S
Molecular Weight: 447.99
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1c(=O)c2c(nc(SCCN3CCCCC3)n2Cc2ccc(Cl)cc2)n(C)c1=O
Standard InChI: InChI=1S/C21H26ClN5O2S/c1-24-18-17(19(28)25(2)21(24)29)27(14-15-6-8-16(22)9-7-15)20(23-18)30-13-12-26-10-4-3-5-11-26/h6-9H,3-5,10-14H2,1-2H3
Standard InChI Key: JITKPWYHHRRNRD-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
3.7399 2.7216 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.4768 -1.1829 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.2858 0.4671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7148 -2.0079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7868 -0.5154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2858 -2.0079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7868 -1.8503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0003 -0.7704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1732 0.2461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5714 -0.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5714 -1.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2858 -0.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3018 -1.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0003 -1.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5318 0.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0838 0.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2858 -2.8329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7148 -0.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0643 -0.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8289 1.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8908 0.7108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3809 2.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4429 1.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7607 -0.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1879 2.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9982 0.2461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7607 0.9605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4107 0.9605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1732 1.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9982 1.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 25 1 0
2 13 1 0
2 19 1 0
3 12 2 0
4 14 2 0
5 10 1 0
5 13 1 0
5 15 1 0
6 11 1 0
6 14 1 0
6 17 1 0
7 11 1 0
7 13 2 0
8 12 1 0
8 14 1 0
8 18 1 0
9 24 1 0
9 26 1 0
9 27 1 0
10 11 2 0
10 12 1 0
15 16 1 0
16 20 2 0
16 21 1 0
19 24 1 0
20 22 1 0
21 23 2 0
22 25 2 0
23 25 1 0
26 28 1 0
27 29 1 0
28 30 1 0
29 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.99Molecular Weight (Monoisotopic): 447.1496AlogP: 2.71#Rotatable Bonds: 6Polar Surface Area: 65.06Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.29CX LogP: 3.70CX LogD: 2.77Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: -1.94
References 1. PubChem BioAssay data set, 2. PubChem BioAssay data set,