The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID17432538 ID: ALA1500138
PubChem CID: 2293262
Max Phase: Preclinical
Molecular Formula: C26H22N2O2S
Molecular Weight: 426.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(Cc2ccccc2)sc(NC(=O)/C=C/c2cccc3ccccc23)c1C(N)=O
Standard InChI: InChI=1S/C26H22N2O2S/c1-17-22(16-18-8-3-2-4-9-18)31-26(24(17)25(27)30)28-23(29)15-14-20-12-7-11-19-10-5-6-13-21(19)20/h2-15H,16H2,1H3,(H2,27,30)(H,28,29)/b15-14+
Standard InChI Key: RNESHKDTTSYYKX-CCEZHUSRSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-1.0131 2.0014 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.7457 1.7043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2516 3.3113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6805 3.3113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3041 3.0633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3480 2.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6805 2.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0930 1.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2680 1.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1326 2.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7831 0.5493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9661 3.7238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4629 6.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1187 -0.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5780 0.5493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2516 5.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4629 7.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9661 4.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2516 4.9613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9661 6.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1773 5.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2516 7.4363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1773 7.4363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6337 -0.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9392 -0.2906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9661 7.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8918 6.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8918 7.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9693 -1.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2747 -1.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7898 -1.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 7 1 0
1 9 1 0
2 10 2 0
3 12 2 0
4 7 1 0
4 12 1 0
5 10 1 0
6 7 2 0
6 8 1 0
6 10 1 0
8 9 2 0
8 15 1 0
9 11 1 0
11 14 1 0
12 18 1 0
13 16 1 0
13 17 1 0
13 21 2 0
14 24 2 0
14 25 1 0
16 19 1 0
16 20 2 0
17 22 1 0
17 23 2 0
18 19 2 0
20 26 1 0
21 27 1 0
22 26 2 0
23 28 1 0
24 29 1 0
25 30 2 0
27 28 2 0
29 31 2 0
30 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.54Molecular Weight (Monoisotopic): 426.1402AlogP: 5.55#Rotatable Bonds: 6Polar Surface Area: 72.19Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.96CX Basic pKa: ┄CX LogP: 6.74CX LogD: 6.74Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: -1.03
References 1. PubChem BioAssay data set,