SID49821734

ID: ALA1500329

PubChem CID: 24818266

Max Phase: Preclinical

Molecular Formula: C18H26N4O5

Molecular Weight: 378.43

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCCN1CCOCC1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1

Standard InChI:  InChI=1S/C18H26N4O5/c23-18(19-4-1-5-20-6-10-26-11-7-20)15-2-3-16(17(14-15)22(24)25)21-8-12-27-13-9-21/h2-3,14H,1,4-13H2,(H,19,23)

Standard InChI Key:  OSFXUDRUKNNMEO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   -1.2568    2.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6858    2.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8292    2.3827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5424   -0.9173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4589    1.1452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4002    1.5577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9713    2.3827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1721    0.3202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0300    0.3202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6858    1.1452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9713    1.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2568    0.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2568    1.1452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6858    0.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9713   -0.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5424   -0.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4002    2.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1147    1.1452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1147    2.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8292    1.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8866   -0.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6011    0.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3155   -0.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7445   -0.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0300    1.1452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4589    0.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7445    1.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  7  1  0
  2  7  2  0
  3 19  1  0
  3 20  1  0
  4 16  2  0
  5 26  1  0
  5 27  1  0
  6 10  1  0
  6 17  1  0
  6 18  1  0
  7 11  1  0
  8 16  1  0
  8 21  1  0
  9 23  1  0
  9 24  1  0
  9 25  1  0
 10 11  1  0
 10 14  2  0
 11 13  2  0
 12 13  1  0
 12 15  2  0
 12 16  1  0
 14 15  1  0
 17 19  1  0
 18 20  1  0
 21 22  1  0
 22 23  1  0
 24 26  1  0
 25 27  1  0
M  CHG  2   1  -1   7   1
M  END

Associated Targets(Human)

MBNL1 Tbio Muscleblind-like protein 1 (34431 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.43Molecular Weight (Monoisotopic): 378.1903AlogP: 0.88#Rotatable Bonds: 7
Polar Surface Area: 97.18Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.98CX LogP: 0.74CX LogD: 0.60
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.43Np Likeness Score: -1.97

References

1. PubChem BioAssay data set, 

Source

Source(1):