SID49680568

ID: ALA1505309

PubChem CID: 5035890

Max Phase: Preclinical

Molecular Formula: C17H17N3O5

Molecular Weight: 343.34

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CNC(=O)c1ccccc1)NCC(O)c1ccc([N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C17H17N3O5/c21-15(12-6-8-14(9-7-12)20(24)25)10-18-16(22)11-19-17(23)13-4-2-1-3-5-13/h1-9,15,21H,10-11H2,(H,18,22)(H,19,23)

Standard InChI Key:  XHRUEUYCPMTIKX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
    0.7317   -2.0808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8406   -4.1433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1262   -5.3808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0186   -2.0808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8751   -4.1433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1262   -4.5558    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1607   -2.9058    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3041   -3.3183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0173   -3.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4117   -4.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7317   -2.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0173   -4.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6972   -2.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6972   -4.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4117   -3.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7330   -3.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0186   -2.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4462   -3.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8751   -3.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5896   -2.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4475   -2.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7330   -4.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1620   -3.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4475   -4.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1620   -4.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 11  1  0
  2  6  1  0
  3  6  2  0
  4 17  2  0
  5 19  2  0
  6 10  1  0
  7 18  1  0
  7 19  1  0
  8 17  1  0
  8 20  1  0
  9 11  1  0
  9 12  2  0
  9 13  1  0
 10 14  2  0
 10 15  1  0
 11 18  1  0
 12 14  1  0
 13 15  2  0
 16 17  1  0
 16 21  2  0
 16 22  1  0
 19 20  1  0
 21 23  1  0
 22 24  2  0
 23 25  2  0
 24 25  1  0
M  CHG  2   2  -1   6   1
M  END

Associated Targets(Human)

MBNL1 Tbio Muscleblind-like protein 1 (34431 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 343.34Molecular Weight (Monoisotopic): 343.1168AlogP: 1.17#Rotatable Bonds: 7
Polar Surface Area: 121.57Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.77CX Basic pKa: CX LogP: 0.98CX LogD: 0.98
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.51Np Likeness Score: -1.21

References

1. PubChem BioAssay data set, 

Source

Source(1):