The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24404692 ID: ALA1525476
PubChem CID: 16026241
Max Phase: Preclinical
Molecular Formula: C21H24FN5O2
Molecular Weight: 397.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(=O)n(CC(=O)N2CCN(c3ccc(F)cc3)CC2)c2c1c(C)nn2C
Standard InChI: InChI=1S/C21H24FN5O2/c1-14-12-18(28)27(21-20(14)15(2)23-24(21)3)13-19(29)26-10-8-25(9-11-26)17-6-4-16(22)5-7-17/h4-7,12H,8-11,13H2,1-3H3
Standard InChI Key: FUPFZEXYKYISAI-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
-1.9018 -5.6551 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.1874 1.3574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1874 0.5324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6163 1.3574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1154 1.5149 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6003 2.1824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9018 -0.7051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9018 -2.3551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3308 1.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3308 2.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1154 2.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6163 3.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9018 1.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9018 2.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6163 0.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9018 0.1199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3704 0.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3704 3.6344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6163 3.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1874 -1.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6163 -1.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9018 -3.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1874 -1.9426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6163 -1.9426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1874 -3.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6163 -3.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9018 -4.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1874 -4.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6163 -4.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 27 1 0
2 13 2 0
3 16 2 0
4 9 1 0
4 13 1 0
4 15 1 0
5 6 1 0
5 9 1 0
5 17 1 0
6 11 2 0
7 16 1 0
7 20 1 0
7 21 1 0
8 22 1 0
8 23 1 0
8 24 1 0
9 10 2 0
10 11 1 0
10 12 1 0
11 18 1 0
12 14 2 0
12 19 1 0
13 14 1 0
15 16 1 0
20 23 1 0
21 24 1 0
22 25 2 0
22 26 1 0
25 28 1 0
26 29 2 0
27 28 2 0
27 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 397.45Molecular Weight (Monoisotopic): 397.1914AlogP: 1.84#Rotatable Bonds: 3Polar Surface Area: 63.37Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.84CX LogP: 1.41CX LogD: 1.41Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.68Np Likeness Score: -1.86
References 1. PubChem BioAssay data set,