The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[2-(6,7-Dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-ethyl]-2-(3-propyl-phenyl)-3H-quinazolin-4-one ID: ALA152590
PubChem CID: 44369110
Max Phase: Preclinical
Molecular Formula: C30H33N3O3
Molecular Weight: 483.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1cccc(-c2nc3ccccc3c(=O)n2CCN2CCc3cc(OC)c(OC)cc3C2)c1
Standard InChI: InChI=1S/C30H33N3O3/c1-4-8-21-9-7-10-23(17-21)29-31-26-12-6-5-11-25(26)30(34)33(29)16-15-32-14-13-22-18-27(35-2)28(36-3)19-24(22)20-32/h5-7,9-12,17-19H,4,8,13-16,20H2,1-3H3
Standard InChI Key: ZWPGIWZXXUHJCV-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-0.4208 -4.0042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4208 -4.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1375 -3.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 -5.2542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8458 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8458 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3000 -5.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1417 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -3.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1417 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7167 -3.5792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8542 -3.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5667 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5625 -2.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8500 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4292 -3.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1458 -2.7750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -6.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0042 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4250 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7042 -2.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5625 -3.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0042 -6.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2750 -2.3292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2792 -3.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0125 -4.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5625 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7167 -5.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7167 -6.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0000 -7.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -2.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2792 -7.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2750 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2750 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2792 -8.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 3 1 0
6 5 1 0
7 2 1 0
8 16 1 0
9 1 1 0
10 20 1 0
11 19 1 0
12 8 1 0
13 12 2 0
14 15 2 0
15 10 1 0
16 11 1 0
17 3 2 0
18 7 2 0
19 9 1 0
20 21 1 0
21 11 1 0
22 5 2 0
23 18 1 0
24 14 1 0
25 13 1 0
26 7 1 0
27 6 2 0
28 26 2 0
29 28 1 0
30 23 1 0
31 25 1 0
32 24 1 0
33 30 1 0
34 22 1 0
35 34 2 0
36 33 1 0
6 4 1 0
27 35 1 0
23 29 2 0
10 8 2 0
13 14 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.61Molecular Weight (Monoisotopic): 483.2522AlogP: 5.09#Rotatable Bonds: 8Polar Surface Area: 56.59Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.85CX LogP: 5.72CX LogD: 5.61Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -0.82
References 1. Wang S, Ryder H, Pretswell I, Depledge P, Milton J, Hancox TC, Dale I, Dangerfield W, Charlton P, Faint R, Dodd R, Hassan S.. (2002) Studies on quinazolinones as dual inhibitors of Pgp and MRP1 in multidrug resistance., 12 (4): [PMID:11844674 ] [10.1016/s0960-894x(01)00804-6 ]