The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID4251186 ID: ALA1528351
PubChem CID: 3244905
Max Phase: Preclinical
Molecular Formula: C24H32FN3O3S
Molecular Weight: 461.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1CS(=O)(=O)CCC(=O)NCCCN1CCN(c2ccccc2F)CC1
Standard InChI: InChI=1S/C24H32FN3O3S/c1-20-7-2-3-8-21(20)19-32(30,31)18-11-24(29)26-12-6-13-27-14-16-28(17-15-27)23-10-5-4-9-22(23)25/h2-5,7-10H,6,11-19H2,1H3,(H,26,29)
Standard InChI Key: RTGQXVBORQBRTH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-5.8852 -3.9648 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.6005 -5.1896 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.1914 -3.1987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5790 -4.7309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5870 -3.0462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0683 -5.8020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2281 -4.7814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0567 -4.3731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7165 -6.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4826 -6.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2995 -3.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6513 -4.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3023 -6.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1862 -4.9855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5987 -7.1289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0656 -4.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3460 -5.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5380 -4.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1308 -6.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1192 -3.6586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1817 -2.9441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2469 -7.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0130 -7.3330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7138 -3.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8763 -4.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4710 -4.1690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8299 -2.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7049 -3.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.5960 -2.7400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1835 -4.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6424 -4.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2906 -4.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 2 0
1 4 2 0
1 12 1 0
1 20 1 0
2 10 1 0
5 28 2 0
6 9 1 0
6 13 1 0
6 14 1 0
7 17 1 0
7 18 1 0
7 25 1 0
8 28 1 0
8 32 1 0
9 10 1 0
9 15 2 0
10 19 2 0
11 12 1 0
11 16 1 0
11 21 2 0
13 17 1 0
14 18 1 0
15 22 1 0
16 24 2 0
16 30 1 0
19 23 1 0
20 26 1 0
21 27 1 0
22 23 2 0
24 29 1 0
25 31 1 0
26 28 1 0
27 29 2 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.60Molecular Weight (Monoisotopic): 461.2148AlogP: 2.77#Rotatable Bonds: 10Polar Surface Area: 69.72Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.93CX LogP: 2.33CX LogD: 2.32Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: -1.87
References 1. PubChem BioAssay data set, 2. PubChem BioAssay data set,