The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[1-(4-Chloro-3-methoxy-1-oxo-1H-isochromen-7-ylcarbamoyl)-2-phenyl-ethyl]-3-(3-phenyl-ureido)-benzamide ID: ALA153668
PubChem CID: 44367841
Max Phase: Preclinical
Molecular Formula: C33H27ClN4O6
Molecular Weight: 611.05
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1oc(=O)c2cc(NC(=O)C(Cc3ccccc3)NC(=O)c3cccc(NC(=O)Nc4ccccc4)c3)ccc2c1Cl
Standard InChI: InChI=1S/C33H27ClN4O6/c1-43-32-28(34)25-16-15-24(19-26(25)31(41)44-32)35-30(40)27(17-20-9-4-2-5-10-20)38-29(39)21-11-8-14-23(18-21)37-33(42)36-22-12-6-3-7-13-22/h2-16,18-19,27H,17H2,1H3,(H,35,40)(H,38,39)(H2,36,37,42)
Standard InChI Key: IMYOQNOHLKPZBZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
8.4667 -3.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4667 -2.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7042 -2.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7042 -3.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9417 -3.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9417 -2.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3500 -0.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4708 -1.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8917 -2.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1167 -1.1292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1250 -2.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6542 -2.0042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5792 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -3.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7083 -0.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2375 -0.7125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1875 -2.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7042 -1.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4167 -2.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4625 -2.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3417 0.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8167 -0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9042 -3.2542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3625 -2.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0542 -1.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7042 -4.6542 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.2292 -3.7792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4250 -3.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0000 -1.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3667 -3.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5917 -2.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8292 -2.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0625 -2.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9917 -3.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9875 -2.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7708 -0.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5917 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1375 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5917 -4.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5333 -1.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7458 -2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1375 -4.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3667 -5.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5208 -2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 2 0
5 4 1 0
6 5 2 0
7 10 1 0
8 15 1 0
9 12 1 0
10 11 1 0
11 9 1 0
12 19 1 0
13 7 1 0
14 5 1 0
15 25 1 0
16 8 1 0
17 6 1 0
18 3 2 0
19 28 1 0
20 8 2 0
21 7 2 0
22 13 2 0
23 9 2 0
24 11 1 0
25 22 1 0
26 4 1 0
27 1 1 0
28 14 2 0
29 16 1 0
30 24 1 0
31 13 1 0
32 31 2 0
33 32 1 0
34 27 1 0
35 29 1 0
36 29 2 0
37 30 1 0
38 30 2 0
39 37 2 0
40 36 1 0
41 35 2 0
42 38 1 0
43 42 2 0
44 40 2 0
6 3 1 0
17 19 2 0
43 39 1 0
33 25 2 0
44 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 611.05Molecular Weight (Monoisotopic): 610.1619AlogP: 6.08#Rotatable Bonds: 9Polar Surface Area: 138.77Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.38CX Basic pKa: ┄CX LogP: 5.81CX LogD: 5.81Aromatic Rings: 5Heavy Atoms: 44QED Weighted: 0.16Np Likeness Score: -0.73
References 1. Kerrigan JE, Oleksyszyn J, Kam CM, Selzler J, Powers JC.. (1995) Mechanism-based isocoumarin inhibitors for human leukocyte elastase. Effect of the 7-amino substituent and 3-alkoxy group in 3-alkoxy-7-amino-4-chloroisocoumarins on inhibitory potency., 38 (3): [PMID:7853347 ] [10.1021/jm00003a017 ]