The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[(S)-1-(4-Chloro-3-methoxy-1-oxo-1H-isochromen-7-ylcarbamoyl)-2-phenyl-ethyl]-4-nitro-benzamide ID: ALA153744
PubChem CID: 10029699
Max Phase: Preclinical
Molecular Formula: C26H20ClN3O7
Molecular Weight: 521.91
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1oc(=O)c2cc(NC(=O)[C@H](Cc3ccccc3)NC(=O)c3ccc([N+](=O)[O-])cc3)ccc2c1Cl
Standard InChI: InChI=1S/C26H20ClN3O7/c1-36-26-22(27)19-12-9-17(14-20(19)25(33)37-26)28-24(32)21(13-15-5-3-2-4-6-15)29-23(31)16-7-10-18(11-8-16)30(34)35/h2-12,14,21H,13H2,1H3,(H,28,32)(H,29,31)/t21-/m0/s1
Standard InChI Key: JTCTXIVHOMNTID-NRFANRHFSA-N
Molfile:
RDKit 2D
37 40 0 0 1 0 0 0 0 0999 V2000
9.4667 -6.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4667 -5.2792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7042 -4.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7042 -6.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -5.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9417 -6.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9417 -5.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8917 -5.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3500 -3.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1167 -3.9542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1250 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6542 -4.8292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0625 -4.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1792 -6.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4708 -4.8542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 -3.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1875 -4.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3000 -6.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7042 -3.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4167 -5.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9042 -6.0792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3417 -2.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3625 -5.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7042 -7.4792 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.8292 -5.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0542 -3.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8167 -3.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2292 -6.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4250 -6.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 -6.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9917 -6.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1375 -6.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -6.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1375 -7.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -7.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 -7.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 2 0
5 13 1 0
6 4 1 0
7 6 2 0
8 12 1 0
9 10 1 0
10 11 1 0
11 8 1 0
12 20 1 0
13 26 2 0
14 6 1 0
15 5 1 0
16 9 1 0
17 7 1 0
18 5 2 0
19 3 2 0
20 30 1 0
21 8 2 0
22 9 2 0
11 23 1 6
24 4 1 0
25 27 2 0
26 28 1 0
27 16 1 0
28 16 2 0
29 1 1 0
30 14 2 0
31 23 1 0
32 29 1 0
33 31 2 0
34 31 1 0
35 33 1 0
36 34 2 0
37 36 1 0
7 3 1 0
17 20 2 0
35 37 2 0
25 13 1 0
M CHG 2 5 1 15 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.91Molecular Weight (Monoisotopic): 521.0990AlogP: 4.34#Rotatable Bonds: 8Polar Surface Area: 140.78Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.67CX Basic pKa: ┄CX LogP: 4.61CX LogD: 4.61Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -0.81
References 1. Kerrigan JE, Oleksyszyn J, Kam CM, Selzler J, Powers JC.. (1995) Mechanism-based isocoumarin inhibitors for human leukocyte elastase. Effect of the 7-amino substituent and 3-alkoxy group in 3-alkoxy-7-amino-4-chloroisocoumarins on inhibitory potency., 38 (3): [PMID:7853347 ] [10.1021/jm00003a017 ]