The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID17513850 ID: ALA1540232
Cas Number: 128156-87-6
PubChem CID: 1674237
Max Phase: Preclinical
Molecular Formula: C23H30N4O3
Molecular Weight: 410.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(O)(C(=O)NNC(=O)CN2CCN(C)CC2)c2ccc(C)cc2)cc1
Standard InChI: InChI=1S/C23H30N4O3/c1-17-4-8-19(9-5-17)23(30,20-10-6-18(2)7-11-20)22(29)25-24-21(28)16-27-14-12-26(3)13-15-27/h4-11,30H,12-16H2,1-3H3,(H,24,28)(H,25,29)
Standard InChI Key: IBKGYLGGLNADHF-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
-1.5874 -0.8074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7144 -1.3305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8578 0.7320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4289 -0.0930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1433 -0.5055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2867 -0.0930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.7157 0.7320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9999 -0.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2854 0.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4124 0.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7144 -0.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2854 1.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2374 0.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5710 -0.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9999 1.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5710 1.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6499 1.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1435 0.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4124 2.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1435 1.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2374 2.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8578 -0.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5723 -0.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8580 1.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6499 2.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0012 -0.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2867 0.7320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7157 -0.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0012 1.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4302 1.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 8 1 0
2 11 2 0
3 22 2 0
4 5 1 0
4 11 1 0
5 22 1 0
6 23 1 0
6 26 1 0
6 27 1 0
7 28 1 0
7 29 1 0
7 30 1 0
8 9 1 0
8 10 1 0
8 11 1 0
9 12 2 0
9 14 1 0
10 13 2 0
10 15 1 0
12 16 1 0
13 17 1 0
14 18 2 0
15 19 2 0
16 20 2 0
17 21 2 0
18 20 1 0
19 21 1 0
20 24 1 0
21 25 1 0
22 23 1 0
26 28 1 0
27 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.52Molecular Weight (Monoisotopic): 410.2318AlogP: 0.93#Rotatable Bonds: 5Polar Surface Area: 84.91Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.34CX Basic pKa: 7.20CX LogP: 1.93CX LogD: 1.71Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: -1.29
References 1. PubChem BioAssay data set,