SID49816152

ID: ALA1544008

PubChem CID: 16422064

Max Phase: Preclinical

Molecular Formula: C18H20N2O6S2

Molecular Weight: 424.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1/C=C1\SC(=O)N(CC(=O)N(C)C2CCS(=O)(=O)C2)C1=O

Standard InChI:  InChI=1S/C18H20N2O6S2/c1-19(13-7-8-28(24,25)11-13)16(21)10-20-17(22)15(27-18(20)23)9-12-5-3-4-6-14(12)26-2/h3-6,9,13H,7-8,10-11H2,1-2H3/b15-9-

Standard InChI Key:  YOBHAGQTHJDQDL-DHDCSXOGSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    0.4768   -3.3713    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7660   -1.4823    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3622   -5.3343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6657   -2.4461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7125   -2.5794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2140   -0.8692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3180   -0.8692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2775   -2.9543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7427   -3.9143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8686   -3.4193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1906   -4.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5630   -4.1918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3302   -3.1998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3535   -2.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5632   -4.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0481   -3.3331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2775   -4.6043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0986   -1.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9920   -4.1918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1785   -2.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4334   -1.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9920   -3.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7064   -4.6043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2041   -4.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7064   -2.9543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4209   -4.1918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4209   -3.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2775   -2.1293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 12  1  0
  1 13  1  0
  2  6  2  0
  2  7  2  0
  2 18  1  0
  2 21  1  0
  3 11  2  0
  4 13  2  0
  5 16  2  0
  8 22  1  0
  8 28  1  0
  9 11  1  0
  9 13  1  0
  9 15  1  0
 10 14  1  0
 10 16  1  0
 10 24  1  0
 11 12  1  0
 12 17  2  0
 14 18  1  0
 14 20  1  0
 15 16  1  0
 17 19  1  0
 19 22  1  0
 19 23  2  0
 20 21  1  0
 22 25  2  0
 23 26  1  0
 25 27  1  0
 26 27  2  0
M  END

Associated Targets(Human)

MBNL1 Tbio Muscleblind-like protein 1 (34431 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.50Molecular Weight (Monoisotopic): 424.0763AlogP: 1.38#Rotatable Bonds: 5
Polar Surface Area: 101.06Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: -0.19CX LogD: -0.19
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.66Np Likeness Score: -2.24

References

1. PubChem BioAssay data set, 

Source

Source(1):