The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,3,5,6-Tetrafluoro-3'-trifluoromethoxy-biphenyl-4-ylcarbamoyl)-cyclopent-1-enecarboxylic acid ID: ALA154623
PubChem CID: 10457096
Max Phase: Preclinical
Molecular Formula: C20H12F7NO4
Molecular Weight: 463.31
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C1=C(C(=O)Nc2c(F)c(F)c(-c3cccc(OC(F)(F)F)c3)c(F)c2F)CCC1
Standard InChI: InChI=1S/C20H12F7NO4/c21-13-12(8-3-1-4-9(7-8)32-20(25,26)27)14(22)16(24)17(15(13)23)28-18(29)10-5-2-6-11(10)19(30)31/h1,3-4,7H,2,5-6H2,(H,28,29)(H,30,31)
Standard InChI Key: HXVDQTDBVMYWOO-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
1.1500 -0.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 -0.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5625 -1.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5625 0.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3917 0.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3917 -1.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3250 -0.5417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0875 0.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9208 0.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3333 0.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6292 -0.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1042 0.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9958 1.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0417 0.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2792 0.8833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3250 0.8833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1708 1.7458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8750 0.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 0.8833 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 -1.9750 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.1417 0.8875 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.1417 -1.9792 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.1042 0.0583 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.1042 1.7083 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.9292 0.8833 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.4833 2.3083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4750 -0.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1375 0.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0417 -1.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2208 -0.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8750 -1.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2875 -0.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 2 0
4 1 1 0
5 4 2 0
6 3 1 0
7 1 1 0
8 7 1 0
9 8 1 0
10 9 2 0
11 2 1 0
12 15 1 0
13 10 1 0
14 11 1 0
15 18 1 0
16 8 2 0
17 13 2 0
18 14 2 0
19 5 1 0
20 6 1 0
21 4 1 0
22 3 1 0
23 12 1 0
24 12 1 0
25 12 1 0
26 13 1 0
27 9 1 0
28 10 1 0
29 11 2 0
30 27 1 0
31 29 1 0
32 31 2 0
2 6 2 0
30 28 1 0
18 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.31Molecular Weight (Monoisotopic): 463.0655AlogP: 5.31#Rotatable Bonds: 5Polar Surface Area: 75.63Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.44CX Basic pKa: ┄CX LogP: 5.81CX LogD: 2.30Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -0.59
References 1. Leban J, Saeb W, Garcia G, Baumgartner R, Kramer B.. (2004) Discovery of a novel series of DHODH inhibitors by a docking procedure and QSAR refinement., 14 (1): [PMID:14684297 ] [10.1016/j.bmcl.2003.10.021 ] 2. Leban J, Kralik M, Mies J, Gassen M, Tentschert K, Baumgartner R.. (2005) SAR, species specificity, and cellular activity of cyclopentene dicarboxylic acid amides as DHODH inhibitors., 15 (21): [PMID:16143532 ] [10.1016/j.bmcl.2005.07.053 ] 3. Baumgartner R, Walloschek M, Kralik M, Gotschlich A, Tasler S, Mies J, Leban J.. (2006) Dual binding mode of a novel series of DHODH inhibitors., 49 (4): [PMID:16480261 ] [10.1021/jm0506975 ] 4. Mancini RS, Barden CJ, Weaver DF, Reed MA.. (2021) Furazans in Medicinal Chemistry., 64 (4.0): [PMID:33569941 ] [10.1021/acs.jmedchem.0c01901 ]