The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID56318532 ID: ALA1564075
PubChem CID: 24686190
Max Phase: Preclinical
Molecular Formula: C23H24N4O4
Molecular Weight: 420.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1ccc(NC(=O)C(C)OC(=O)/C(C#N)=C/c2ccc(N(C)C)cc2)cc1
Standard InChI: InChI=1S/C23H24N4O4/c1-15(22(29)26-20-9-7-19(8-10-20)25-16(2)28)31-23(30)18(14-24)13-17-5-11-21(12-6-17)27(3)4/h5-13,15H,1-4H3,(H,25,28)(H,26,29)/b18-13+
Standard InChI Key: ITMISWFOAMINQG-QGOAFFKASA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
1.5478 -3.6103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8333 -4.8478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9767 -2.7853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9780 -2.3728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6912 -4.0228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4535 -2.3728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5491 -2.3728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1188 -1.9603 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1188 -3.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8333 -4.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2622 -4.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9767 -3.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3101 -3.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4056 -3.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5956 -4.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7391 -2.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8346 -2.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4056 -2.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1201 -4.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0246 -4.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3101 -2.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7391 -3.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0246 -2.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1201 -2.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8346 -3.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1188 -2.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2622 -4.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2635 -2.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1680 -2.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4535 -1.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2635 -3.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 10 1 0
1 11 1 0
2 10 2 0
3 12 2 0
4 28 2 0
5 12 1 0
5 14 1 0
6 16 1 0
6 29 1 0
6 30 1 0
7 17 1 0
7 28 1 0
8 26 3 0
9 10 1 0
9 15 2 0
9 26 1 0
11 12 1 0
11 27 1 0
13 15 1 0
13 20 2 0
13 21 1 0
14 18 2 0
14 19 1 0
16 22 2 0
16 23 1 0
17 24 2 0
17 25 1 0
18 24 1 0
19 25 2 0
20 22 1 0
21 23 2 0
28 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.47Molecular Weight (Monoisotopic): 420.1798AlogP: 3.19#Rotatable Bonds: 7Polar Surface Area: 111.53Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.95CX Basic pKa: 4.46CX LogP: 3.15CX LogD: 3.15Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: -1.19
References 1. PubChem BioAssay data set,