The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID859777 ID: ALA1565261
Cas Number: 618366-46-4
PubChem CID: 661079
Max Phase: Preclinical
Molecular Formula: C24H25N3O4
Molecular Weight: 419.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCN1C(=O)C(O)=C(C(=O)c2cc3ccccc3o2)C1c1cccnc1
Standard InChI: InChI=1S/C24H25N3O4/c1-3-26(4-2)12-13-27-21(17-9-7-11-25-15-17)20(23(29)24(27)30)22(28)19-14-16-8-5-6-10-18(16)31-19/h5-11,14-15,21,29H,3-4,12-13H2,1-2H3
Standard InChI Key: HRPCARBJXGVSEC-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
4.9607 -0.8631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3808 -1.8353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0470 -3.0363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2383 0.5188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2463 -1.8033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5687 1.0144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0715 -1.9895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2383 -0.9101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4178 -0.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5738 -1.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9607 -2.2158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6508 -0.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8658 -0.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4758 -0.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4926 -2.1389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7453 -0.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7453 0.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9607 0.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1207 0.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0588 -0.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8251 -1.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4598 -1.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4598 0.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5068 0.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7617 0.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1743 -0.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1743 0.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0148 -2.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3496 -1.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7684 -3.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 14 1 0
1 16 1 0
2 10 1 0
3 11 2 0
4 12 2 0
5 9 1 0
5 11 1 0
5 15 1 0
6 19 2 0
6 25 1 0
7 21 1 0
7 28 1 0
7 29 1 0
8 9 1 0
8 10 2 0
8 12 1 0
9 13 1 0
10 11 1 0
12 14 1 0
13 19 1 0
13 20 2 0
14 18 2 0
15 21 1 0
16 17 1 0
16 22 2 0
17 18 1 0
17 23 2 0
20 24 1 0
22 26 1 0
23 27 1 0
24 25 2 0
26 27 2 0
28 30 1 0
29 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.48Molecular Weight (Monoisotopic): 419.1845AlogP: 3.75#Rotatable Bonds: 8Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.61CX Basic pKa: 8.29CX LogP: 1.66CX LogD: 0.88Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.56Np Likeness Score: -1.36
References 1. PubChem BioAssay data set,