The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID26729910 ID: ALA1572640
PubChem CID: 2814104
Max Phase: Preclinical
Molecular Formula: C25H23N3O2S3
Molecular Weight: 493.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(-c2ccc(S(=O)(=O)N3CCN(C4c5ccccc5-c5ccccc54)CC3)s2)cs1
Standard InChI: InChI=1S/C25H23N3O2S3/c1-17-26-22(16-31-17)23-10-11-24(32-23)33(29,30)28-14-12-27(13-15-28)25-20-8-4-2-6-18(20)19-7-3-5-9-21(19)25/h2-11,16,25H,12-15H2,1H3
Standard InChI Key: BMHSCVUUBDLZNV-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
0.6418 -1.3552 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.3093 -0.0453 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.6192 2.1914 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.4668 -1.3552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1832 -1.3552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6418 -3.8302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6418 -2.1802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2843 2.1914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6418 -4.6552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3093 -5.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0256 -5.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0543 -5.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2293 -5.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6418 -0.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0726 -3.4177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3563 -3.4177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1162 -4.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8326 -4.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0543 0.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6064 -6.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3227 -6.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0726 -2.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3563 -2.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0256 -0.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5393 1.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2293 0.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6683 -5.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3846 -5.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -6.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1297 -6.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3643 1.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9518 2.6763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9518 3.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 4 2 0
1 5 2 0
1 7 1 0
1 14 1 0
2 14 1 0
2 19 1 0
3 31 1 0
3 32 1 0
6 9 1 0
6 15 1 0
6 16 1 0
7 22 1 0
7 23 1 0
8 25 1 0
8 32 2 0
9 10 1 0
9 11 1 0
10 12 1 0
10 17 2 0
11 13 1 0
11 18 2 0
12 13 1 0
12 20 2 0
13 21 2 0
14 24 2 0
15 22 1 0
16 23 1 0
17 27 1 0
18 28 1 0
19 25 1 0
19 26 2 0
20 29 1 0
21 30 1 0
24 26 1 0
25 31 2 0
27 29 2 0
28 30 2 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.68Molecular Weight (Monoisotopic): 493.0952AlogP: 5.26#Rotatable Bonds: 4Polar Surface Area: 53.51Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.95CX LogP: 4.81CX LogD: 4.80Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -1.56
References 1. PubChem BioAssay data set, 2. (2017) Inhibitors of grb2-associated binding protein 1 (gab1) and methods of treating cancer using the same,