SID49827851

ID: ALA1575773

PubChem CID: 9150748

Max Phase: Preclinical

Molecular Formula: C21H18FN3O4

Molecular Weight: 395.39

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CCN1C(=O)c2ccc(C(=O)N(C)CC(=O)Nc3cccc(F)c3)cc2C1=O

Standard InChI:  InChI=1S/C21H18FN3O4/c1-3-9-25-20(28)16-8-7-13(10-17(16)21(25)29)19(27)24(2)12-18(26)23-15-6-4-5-14(22)11-15/h3-8,10-11H,1,9,12H2,2H3,(H,23,26)

Standard InChI Key:  VTSVQHAYOWIHSF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    3.1584    3.5215    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3114    0.4194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3114    3.3235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1284    0.2215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0150    2.2840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5413    1.8715    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4139    1.4590    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7295    1.0465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2718    1.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2718    2.2840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0564    1.2040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0564    2.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5573    1.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8428    1.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5573    2.6965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8428    2.2840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1284    1.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3663    1.8715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3006    1.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7788    2.5859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0150    1.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4440    1.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4139    2.2840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4440    2.2840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1584    2.6965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1584    1.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6038    2.5859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8729    2.2840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8729    1.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 25  1  0
  2 11  2  0
  3 12  2  0
  4 17  2  0
  5 21  2  0
  6 11  1  0
  6 12  1  0
  6 18  1  0
  7 17  1  0
  7 19  1  0
  7 23  1  0
  8 21  1  0
  8 22  1  0
  9 10  1  0
  9 11  1  0
  9 13  2  0
 10 12  1  0
 10 15  2  0
 13 14  1  0
 14 16  2  0
 14 17  1  0
 15 16  1  0
 18 20  1  0
 19 21  1  0
 20 27  2  0
 22 24  1  0
 22 26  2  0
 24 25  2  0
 25 28  1  0
 26 29  1  0
 28 29  2  0
M  END

Associated Targets(Human)

MBNL1 Tbio Muscleblind-like protein 1 (34431 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.39Molecular Weight (Monoisotopic): 395.1281AlogP: 2.32#Rotatable Bonds: 6
Polar Surface Area: 86.79Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.98CX Basic pKa: CX LogP: 2.00CX LogD: 2.00
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.60Np Likeness Score: -2.01

References

1. PubChem BioAssay data set, 

Source

Source(1):