{3-[2-(4-Bromo-2-fluoro-phenoxymethyl)-3-methyl-benzofuran-4-yloxy]-propyl}-pyridin-3-ylmethyl-amine

ID: ALA158185

PubChem CID: 491352

Max Phase: Preclinical

Molecular Formula: C25H24BrFN2O3

Molecular Weight: 499.38

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(COc2ccc(Br)cc2F)oc2cccc(OCCCNCc3cccnc3)c12

Standard InChI:  InChI=1S/C25H24BrFN2O3/c1-17-24(16-31-21-9-8-19(26)13-20(21)27)32-23-7-2-6-22(25(17)23)30-12-4-11-29-15-18-5-3-10-28-14-18/h2-3,5-10,13-14,29H,4,11-12,15-16H2,1H3

Standard InChI Key:  KNRFDGJIUZNLSO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    6.0042   -7.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5167   -6.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7292   -6.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5250   -7.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7375   -7.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4875   -8.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3125   -8.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -7.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0750   -7.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0167   -6.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2500   -7.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0042   -4.1917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4750   -7.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7167   -7.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5792   -4.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9000   -9.0917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.3000   -7.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1542   -4.2042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7292   -5.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0167   -7.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5417   -7.7875    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    4.0125   -5.4500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2875   -3.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7250   -4.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8667   -3.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3042   -7.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3042   -6.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0042   -5.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4375   -3.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7292   -5.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5792   -5.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2917   -5.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  4  1  0
  6  9  2  0
  7  6  1  0
  8  1  1  0
  9 11  1  0
 10  3  2  0
 11  8  1  0
 12 23  2  0
 13  9  1  0
 14 17  1  0
 15 25  1  0
 16  6  1  0
 17 13  2  0
 18 29  1  0
 19  2  1  0
 20  5  2  0
 21 14  1  0
 22 10  1  0
 23 15  1  0
 24 30  1  0
 25 18  1  0
 26 20  1  0
 27 10  1  0
 28 32  2  0
 29 24  1  0
 30 22  1  0
 31 15  2  0
 32 31  1  0
  5  3  1  0
 26 27  2  0
 14  7  2  0
 28 12  1  0
M  END

Associated Targets(Human)

NMT1 Tchem Peptide N-myristoyltransferase (241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Candida albicans (78123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.38Molecular Weight (Monoisotopic): 498.0954AlogP: 6.18#Rotatable Bonds: 10
Polar Surface Area: 56.52Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.80CX LogP: 5.09CX LogD: 3.68
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -1.02

References

1. Ebiike H, Masubuchi M, Liu P, Kawasaki K, Morikami K, Sogabe S, Hayase M, Fujii T, Sakata K, Shindoh H, Shiratori Y, Aoki Y, Ohtsuka T, Shimma N..  (2002)  Design and synthesis of novel benzofurans as a new class of antifungal agents targeting fungal N-myristoyltransferase. Part 2.,  12  (4): [PMID:11844682] [10.1016/s0960-894x(01)00808-3]

Source