The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[({[3-({[(4-carboxyphenyl)amino]carbonothioyl}amino)phenyl]amino}carbonothioyl)amino]benzoic acid ID: ALA158211
PubChem CID: 44373178
Max Phase: Preclinical
Molecular Formula: C22H18N4O4S2
Molecular Weight: 466.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(/N=C(\S)Nc2cccc(/N=C(/S)Nc3ccc(C(=O)O)cc3)c2)cc1
Standard InChI: InChI=1S/C22H18N4O4S2/c27-19(28)13-4-8-15(9-5-13)23-21(31)25-17-2-1-3-18(12-17)26-22(32)24-16-10-6-14(7-11-16)20(29)30/h1-12H,(H,27,28)(H,29,30)(H2,23,25,31)(H2,24,26,32)
Standard InChI Key: JZQBYEVSORHVJB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
3.3042 -0.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -3.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8667 0.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3125 -1.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -0.9417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0292 -3.4250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -3.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -0.9417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -2.1792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 0.2958 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.6000 -2.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1542 0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3125 -2.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3125 -3.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -1.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8667 1.5375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3042 -0.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1625 -0.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8792 -1.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 0.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6000 -3.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1667 -3.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -0.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0292 -2.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5875 0.3083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1667 -2.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4500 -0.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7292 0.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8875 -3.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -3.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -3.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -2.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 12 1 0
4 11 1 0
5 1 2 0
6 14 1 0
7 2 2 0
8 1 1 0
9 2 1 0
10 1 1 0
11 21 2 0
12 20 2 0
13 15 2 0
14 13 1 0
15 5 1 0
16 3 2 0
17 4 2 0
18 27 2 0
19 26 2 0
20 28 1 0
21 29 1 0
22 7 1 0
23 8 1 0
24 4 1 0
25 3 1 0
26 22 1 0
27 23 1 0
28 23 2 0
29 22 2 0
30 32 2 0
31 30 1 0
32 15 1 0
12 18 1 0
14 31 2 0
11 19 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.54Molecular Weight (Monoisotopic): 466.0769AlogP: 5.14#Rotatable Bonds: 6Polar Surface Area: 123.38Molecular Species: ZWITTERIONHBA: 4HBD: 6#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: -0.56CX Basic pKa: 13.97CX LogP: 4.94CX LogD: 1.50Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.17Np Likeness Score: -0.87
References 1. Phuong T, Khac-Minh T, Van Ha NT, Ngoc Phuong HT.. (2004) Synthesis and antifungal activities of phenylenedithioureas., 14 (3): [PMID:14741262 ] [10.1016/j.bmcl.2003.11.044 ]