The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID862649 ID: ALA1586527
PubChem CID: 5389759
Max Phase: Preclinical
Molecular Formula: C23H26N2O5
Molecular Weight: 410.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COCCCN1C(=O)C(O)=C(C(=O)c2ccc(OC(C)C)cc2)C1c1ccncc1
Standard InChI: InChI=1S/C23H26N2O5/c1-15(2)30-18-7-5-17(6-8-18)21(26)19-20(16-9-11-24-12-10-16)25(13-4-14-29-3)23(28)22(19)27/h5-12,15,20,27H,4,13-14H2,1-3H3
Standard InChI Key: URTOGTLCYVIIDU-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
2.4132 -2.6150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2122 -3.9488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0308 -0.3932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7977 -0.7156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5709 -2.8063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2870 -2.8063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4661 -0.3297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1802 -1.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3732 -1.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5927 -2.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0406 -3.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5157 -1.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2399 -1.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3362 -0.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4275 -3.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0684 -0.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0245 -1.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6718 -0.2207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8211 -1.6418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1420 -2.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6815 -0.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6376 -1.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9772 -0.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4923 -0.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6416 -1.5556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8564 -3.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2826 -1.3831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1031 -1.2969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9470 -2.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2854 -3.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 10 1 0
2 11 2 0
3 12 2 0
4 23 1 0
4 27 1 0
5 26 1 0
5 30 1 0
6 9 1 0
6 11 1 0
6 15 1 0
7 21 2 0
7 22 1 0
8 9 1 0
8 10 2 0
8 12 1 0
9 13 1 0
10 11 1 0
12 14 1 0
13 16 2 0
13 17 1 0
14 18 2 0
14 19 1 0
15 20 1 0
16 21 1 0
17 22 2 0
18 24 1 0
19 25 2 0
20 26 1 0
23 24 2 0
23 25 1 0
27 28 1 0
27 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.47Molecular Weight (Monoisotopic): 410.1842AlogP: 3.48#Rotatable Bonds: 9Polar Surface Area: 88.96Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.46CX Basic pKa: 4.03CX LogP: 1.66CX LogD: 1.66Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.50Np Likeness Score: -1.25
References 1. PubChem BioAssay data set,