The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID14727638 ID: ALA1589219
PubChem CID: 4047051
Max Phase: Preclinical
Molecular Formula: C22H27BrN4O3S
Molecular Weight: 507.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(C)c(C(=O)Nc2ccc(S(=O)(=O)NC34CC5CC(CC(C5)C3)C4)cc2)c1Br
Standard InChI: InChI=1S/C22H27BrN4O3S/c1-13-19(23)20(27(2)25-13)21(28)24-17-3-5-18(6-4-17)31(29,30)26-22-10-14-7-15(11-22)9-16(8-14)12-22/h3-6,14-16,26H,7-12H2,1-2H3,(H,24,28)
Standard InChI Key: SVHQROLGRUFHQQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
-3.8725 1.8011 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1.3395 2.3089 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.9270 3.0233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7521 1.5944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2328 1.8962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0540 2.7214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0334 -0.1618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8404 -0.3334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5183 0.6587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0539 3.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3185 3.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0539 4.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7895 3.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7679 3.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5034 5.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2390 3.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7679 4.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5034 3.5893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2390 4.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6251 1.8964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9472 0.6587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7009 0.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2328 1.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6251 1.0714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0894 2.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2529 0.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8038 1.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0893 0.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8039 1.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4203 -0.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0734 0.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 22 1 0
2 3 2 0
2 4 2 0
2 6 1 0
2 20 1 0
5 23 2 0
6 10 1 0
7 8 1 0
7 21 1 0
7 30 1 0
8 26 2 0
9 23 1 0
9 27 1 0
10 11 1 0
16 18 1 0
10 13 1 0
11 14 1 0
12 15 1 0
13 16 1 0
15 19 1 0
14 18 1 0
15 17 1 0
14 17 1 0
10 12 1 0
16 19 1 0
20 24 2 0
20 25 1 0
21 22 2 0
21 23 1 0
22 26 1 0
24 28 1 0
25 29 2 0
26 31 1 0
27 28 2 0
27 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.45Molecular Weight (Monoisotopic): 506.0987AlogP: 3.99#Rotatable Bonds: 5Polar Surface Area: 93.09Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.19CX Basic pKa: 1.34CX LogP: 3.23CX LogD: 3.23Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -1.53
References 1. PubChem BioAssay data set,