The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 4-[4-[4-methyloxycarbonylanilino(thioxo)methylamino]anilino(thioxo)methylamino]benzoate ID: ALA159057
PubChem CID: 44372957
Max Phase: Preclinical
Molecular Formula: C24H22N4O4S2
Molecular Weight: 494.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(/N=C(\S)Nc2ccc(/N=C(\S)Nc3ccc(C(=O)OC)cc3)cc2)cc1
Standard InChI: InChI=1S/C24H22N4O4S2/c1-31-21(29)15-3-7-17(8-4-15)25-23(33)27-19-11-13-20(14-12-19)28-24(34)26-18-9-5-16(6-10-18)22(30)32-2/h3-14H,1-2H3,(H2,25,27,33)(H2,26,28,34)
Standard InChI Key: PBDOSLCTGMCIND-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
2.3667 -4.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3000 -0.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8625 0.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6417 -6.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5875 -4.4250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0125 -1.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5292 -5.5042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5792 -1.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9917 -4.1542 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.2917 0.1208 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.8667 -6.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1500 0.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8625 1.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8042 -7.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7042 -5.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1542 -0.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2417 -6.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4292 0.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7292 -0.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -5.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5875 -3.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5875 -1.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5792 0.1333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2667 -6.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4417 -1.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7167 0.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9250 -5.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4625 -6.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8750 -2.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3042 -3.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3042 -2.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8750 -3.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2917 0.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0500 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 8 1 0
3 12 1 0
4 11 1 0
5 1 2 0
6 2 2 0
7 1 1 0
8 22 1 0
9 1 1 0
10 2 1 0
11 17 2 0
12 18 2 0
13 3 2 0
14 4 2 0
15 27 2 0
16 25 2 0
17 28 1 0
18 26 1 0
19 6 1 0
20 7 1 0
21 5 1 0
22 29 1 0
23 3 1 0
24 4 1 0
25 19 1 0
26 19 2 0
27 20 1 0
28 20 2 0
29 32 2 0
30 21 2 0
31 30 1 0
32 21 1 0
33 23 1 0
34 24 1 0
15 11 1 0
22 31 2 0
12 16 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.60Molecular Weight (Monoisotopic): 494.1082AlogP: 5.32#Rotatable Bonds: 6Polar Surface Area: 101.38Molecular Species: ZWITTERIONHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: -0.46CX Basic pKa: 14.95CX LogP: 8.03CX LogD: 7.35Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.16Np Likeness Score: -0.64
References 1. Phuong T, Khac-Minh T, Van Ha NT, Ngoc Phuong HT.. (2004) Synthesis and antifungal activities of phenylenedithioureas., 14 (3): [PMID:14741262 ] [10.1016/j.bmcl.2003.11.044 ]