The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(2-{2-[3-(2-Amino-ethyl)-1H-indol-5-yloxy]-acetylamino}-acetylamino)-3-(4-hydroxy-phenyl)-propionamide ID: ALA159174
Cas Number: 133790-08-6
PubChem CID: 131670
Max Phase: Preclinical
Molecular Formula: C23H27N5O5
Molecular Weight: 453.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NCCc1c[nH]c2ccc(OCC(=O)NCC(=O)N[C@@H](Cc3ccc(O)cc3)C(N)=O)cc12
Standard InChI: InChI=1S/C23H27N5O5/c24-8-7-15-11-26-19-6-5-17(10-18(15)19)33-13-22(31)27-12-21(30)28-20(23(25)32)9-14-1-3-16(29)4-2-14/h1-6,10-11,20,26,29H,7-9,12-13,24H2,(H2,25,32)(H,27,31)(H,28,30)/t20-/m0/s1
Standard InChI Key: ZRVNSPYTGPNZTB-FQEVSTJZSA-N
Molfile:
RDKit 2D
33 35 0 0 1 0 0 0 0 0999 V2000
10.6375 -12.5792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0417 -11.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2667 -12.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2750 -11.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8750 -10.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6167 -10.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3250 -10.7375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0292 -12.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8125 -10.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1292 -10.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4167 -11.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2625 -10.7292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6167 -9.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8667 -11.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8125 -9.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5792 -9.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4167 -12.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9792 -10.7125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5542 -11.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8042 -11.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1792 -11.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5667 -11.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8542 -8.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3042 -7.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8000 -12.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0542 -9.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8542 -7.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9917 -10.7167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3000 -8.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0792 -7.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4708 -7.5125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7917 -11.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4792 -11.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 8 2 0
3 1 1 0
4 3 2 0
5 6 1 0
6 7 1 0
7 9 1 0
8 1 1 0
9 19 1 0
10 22 1 0
11 2 1 0
12 10 1 0
6 13 1 6
14 5 2 0
15 9 2 0
16 10 2 0
17 8 1 0
18 5 1 0
19 12 1 0
20 25 1 0
21 20 1 0
22 21 1 0
23 13 1 0
24 30 2 0
25 17 2 0
26 23 1 0
27 23 2 0
28 33 1 0
29 26 2 0
30 27 1 0
31 24 1 0
32 4 1 0
33 32 1 0
2 4 1 0
11 20 2 0
24 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.50Molecular Weight (Monoisotopic): 453.2012AlogP: 0.08#Rotatable Bonds: 11Polar Surface Area: 172.56Molecular Species: BASEHBA: 6HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 8#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.50CX Basic pKa: 9.95CX LogP: -1.02CX LogD: -2.51Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.24Np Likeness Score: -0.45
References 1. Perez M, Pauwels P, Palmier C, John GW, Valentin J, Halazy S. (1995) 5-O-Carboxymethyl piperazide derivatives of serotonin: a new class of potent and selective 5-HT1D receptor agonists, 5 (7): [10.1016/0960-894X(95)00091-7 ]