(S)-2-(2-{2-[3-(2-Amino-ethyl)-1H-indol-5-yloxy]-acetylamino}-acetylamino)-3-(4-hydroxy-phenyl)-propionamide

ID: ALA159174

Cas Number: 133790-08-6

PubChem CID: 131670

Max Phase: Preclinical

Molecular Formula: C23H27N5O5

Molecular Weight: 453.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCCc1c[nH]c2ccc(OCC(=O)NCC(=O)N[C@@H](Cc3ccc(O)cc3)C(N)=O)cc12

Standard InChI:  InChI=1S/C23H27N5O5/c24-8-7-15-11-26-19-6-5-17(10-18(15)19)33-13-22(31)27-12-21(30)28-20(23(25)32)9-14-1-3-16(29)4-2-14/h1-6,10-11,20,26,29H,7-9,12-13,24H2,(H2,25,32)(H,27,31)(H,28,30)/t20-/m0/s1

Standard InChI Key:  ZRVNSPYTGPNZTB-FQEVSTJZSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  1  0  0  0  0  0999 V2000
   10.6375  -12.5792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0417  -11.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2667  -12.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2750  -11.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8750  -10.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6167  -10.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3250  -10.7375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0292  -12.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8125  -10.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1292  -10.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4167  -11.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2625  -10.7292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6167   -9.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8667  -11.6167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8125   -9.8417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5792   -9.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4167  -12.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9792  -10.7125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5542  -11.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8042  -11.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1792  -11.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5667  -11.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8542   -8.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3042   -7.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8000  -12.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0542   -9.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8542   -7.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9917  -10.7167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3000   -8.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0792   -7.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4708   -7.5125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7917  -11.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4792  -11.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  8  2  0
  3  1  1  0
  4  3  2  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  1  1  0
  9 19  1  0
 10 22  1  0
 11  2  1  0
 12 10  1  0
  6 13  1  6
 14  5  2  0
 15  9  2  0
 16 10  2  0
 17  8  1  0
 18  5  1  0
 19 12  1  0
 20 25  1  0
 21 20  1  0
 22 21  1  0
 23 13  1  0
 24 30  2  0
 25 17  2  0
 26 23  1  0
 27 23  2  0
 28 33  1  0
 29 26  2  0
 30 27  1  0
 31 24  1  0
 32  4  1  0
 33 32  1  0
  2  4  1  0
 11 20  2  0
 24 29  1  0
M  END

Alternative Forms

Associated Targets(non-human)

HTR1D Serotonin 1d (5-HT1d) receptor (36 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.50Molecular Weight (Monoisotopic): 453.2012AlogP: 0.08#Rotatable Bonds: 11
Polar Surface Area: 172.56Molecular Species: BASEHBA: 6HBD: 6
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 8#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.50CX Basic pKa: 9.95CX LogP: -1.02CX LogD: -2.51
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.24Np Likeness Score: -0.45

References

1. Perez M, Pauwels P, Palmier C, John GW, Valentin J, Halazy S.  (1995)  5-O-Carboxymethyl piperazide derivatives of serotonin: a new class of potent and selective 5-HT1D receptor agonists,  (7): [10.1016/0960-894X(95)00091-7]

Source