The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24407318 ID: ALA1591912
PubChem CID: 16028723
Max Phase: Preclinical
Molecular Formula: C22H25ClN4O3S
Molecular Weight: 460.99
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCn1ccc2cc(S(=O)(=O)N3CCCN(C(=O)Nc4cccc(Cl)c4)CC3)ccc21
Standard InChI: InChI=1S/C22H25ClN4O3S/c1-2-25-12-9-17-15-20(7-8-21(17)25)31(29,30)27-11-4-10-26(13-14-27)22(28)24-19-6-3-5-18(23)16-19/h3,5-9,12,15-16H,2,4,10-11,13-14H2,1H3,(H,24,28)
Standard InChI Key: CDSLCPKDFPWTBX-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
3.4666 1.4195 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.7748 1.9434 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.3623 2.6578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1873 1.2289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9985 1.6044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0604 1.5309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7029 3.4358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2890 0.9844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 0.1795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4893 2.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9182 2.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9182 3.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2038 1.9434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4893 3.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2038 3.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7029 2.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3787 1.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1878 2.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1220 0.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5904 1.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9578 4.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5172 0.1470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5337 0.9228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7015 0.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7144 0.1178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1791 0.7995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7648 4.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0723 -0.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0018 0.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8950 -0.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3598 -0.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 29 1 0
2 3 2 0
2 4 2 0
2 6 1 0
2 10 1 0
5 23 2 0
6 17 1 0
6 19 1 0
7 12 1 0
7 18 1 0
7 21 1 0
8 20 1 0
8 23 1 0
8 24 1 0
9 23 1 0
9 25 1 0
10 13 1 0
10 14 2 0
11 12 1 0
11 13 2 0
11 16 1 0
12 15 2 0
14 15 1 0
16 18 2 0
17 20 1 0
19 22 1 0
21 27 1 0
22 24 1 0
25 26 2 0
25 28 1 0
26 29 1 0
28 30 2 0
29 31 2 0
30 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.99Molecular Weight (Monoisotopic): 460.1336AlogP: 4.24#Rotatable Bonds: 4Polar Surface Area: 74.65Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.09CX Basic pKa: ┄CX LogP: 3.35CX LogD: 3.35Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.63Np Likeness Score: -2.49
References 1. PubChem BioAssay data set,