The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
isopropyl 2-hydroxy-4-[3-[3-hydroxy-4-isopropyloxycarbonylanilino(thioxo)methylamino]anilino(thioxo)methylamino]benzoate ID: ALA159238
PubChem CID: 10031190
Max Phase: Preclinical
Molecular Formula: C28H30N4O6S2
Molecular Weight: 582.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)c1ccc(/N=C(\S)Nc2cccc(/N=C(/S)Nc3ccc(C(=O)OC(C)C)c(O)c3)c2)cc1O
Standard InChI: InChI=1S/C28H30N4O6S2/c1-15(2)37-25(35)21-10-8-19(13-23(21)33)31-27(39)29-17-6-5-7-18(12-17)30-28(40)32-20-9-11-22(24(34)14-20)26(36)38-16(3)4/h5-16,33-34H,1-4H3,(H2,29,31,39)(H2,30,32,40)
Standard InChI Key: MWSMXTPCJJQMNW-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 42 0 0 0 0 0 0 0 0999 V2000
4.9375 0.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3792 -2.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6500 0.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0917 -1.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0875 -0.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5167 -3.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2167 0.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3792 -3.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6667 -3.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5042 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6542 -1.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9417 -0.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2375 -3.6167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8000 -1.1417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 -3.6250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3667 -1.1417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3667 0.1083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8042 -2.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0792 0.0958 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5167 -2.3792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5167 -0.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9500 -3.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6500 1.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0875 -1.1417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0917 -2.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0917 -3.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3750 -1.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9417 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2292 -1.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2125 1.3333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0917 -3.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0792 0.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5167 -1.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6625 -3.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3750 -3.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6625 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0792 1.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2292 -2.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7917 0.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5167 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 11 2 0
3 1 1 0
4 2 1 0
5 14 1 0
6 15 1 0
7 1 2 0
8 9 2 0
9 22 1 0
10 7 1 0
11 28 1 0
12 1 1 0
13 6 2 0
14 21 1 0
15 26 1 0
16 5 2 0
17 3 1 0
18 4 1 0
19 5 1 0
20 6 1 0
21 29 1 0
22 13 1 0
23 3 2 0
24 4 2 0
25 27 2 0
26 25 1 0
27 16 1 0
28 22 2 0
29 12 2 0
30 7 1 0
31 8 1 0
32 17 1 0
33 18 1 0
34 36 2 0
35 34 1 0
36 27 1 0
37 32 1 0
38 33 1 0
39 32 1 0
40 33 1 0
21 10 2 0
26 35 2 0
2 8 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 582.70Molecular Weight (Monoisotopic): 582.1607AlogP: 6.29#Rotatable Bonds: 8Polar Surface Area: 141.84Molecular Species: ZWITTERIONHBA: 8HBD: 6#RO5 Violations: 3HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: -0.62CX Basic pKa: 13.71CX LogP: 10.13CX LogD: 9.42Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.08Np Likeness Score: -0.67
References 1. Phuong T, Khac-Minh T, Van Ha NT, Ngoc Phuong HT.. (2004) Synthesis and antifungal activities of phenylenedithioureas., 14 (3): [PMID:14741262 ] [10.1016/j.bmcl.2003.11.044 ]