The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24384808 ID: ALA1598333
PubChem CID: 16008581
Max Phase: Preclinical
Molecular Formula: C25H30N4O4
Molecular Weight: 450.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(CN2CCN(c3ccccc3OC)CC2)NC(=O)NC1c1ccccc1
Standard InChI: InChI=1S/C25H30N4O4/c1-3-33-24(30)22-19(26-25(31)27-23(22)18-9-5-4-6-10-18)17-28-13-15-29(16-14-28)20-11-7-8-12-21(20)32-2/h4-12,23H,3,13-17H2,1-2H3,(H2,26,27,31)
Standard InChI Key: POMBZGOAYUWIPI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
7.2560 -5.7531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8270 -5.7531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5415 -2.0406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5402 -4.1031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2560 -3.2781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8270 -3.2781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3981 -4.1031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9692 -3.2781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5415 -4.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2560 -4.1031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8270 -4.1031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9704 -4.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5415 -5.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5415 -2.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1126 -4.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2547 -2.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6849 -4.1031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9704 -5.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6836 -4.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3981 -3.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9692 -4.1031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6836 -2.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5402 -3.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2547 -2.0406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3994 -4.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6849 -5.7531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8257 -2.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3994 -5.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5402 -1.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2560 -6.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8257 -2.0406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8257 -4.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5415 -6.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 13 1 0
1 30 1 0
2 13 2 0
3 14 2 0
4 23 1 0
4 32 1 0
5 10 1 0
5 14 1 0
6 11 1 0
6 14 1 0
7 15 1 0
7 19 1 0
7 20 1 0
8 16 1 0
8 21 1 0
8 22 1 0
9 10 1 0
9 11 2 0
9 13 1 0
10 12 1 0
11 15 1 0
12 17 2 0
12 18 1 0
16 23 2 0
16 24 1 0
17 25 1 0
18 26 2 0
19 21 1 0
20 22 1 0
23 27 1 0
24 29 2 0
25 28 2 0
26 28 1 0
27 31 2 0
29 31 1 0
30 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.54Molecular Weight (Monoisotopic): 450.2267AlogP: 2.69#Rotatable Bonds: 7Polar Surface Area: 83.14Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.49CX Basic pKa: 5.67CX LogP: 2.48CX LogD: 2.47Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.63Np Likeness Score: -1.27
References 1. PubChem BioAssay data set,