The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID14736372 ID: ALA1598647
PubChem CID: 2903349
Max Phase: Preclinical
Molecular Formula: C20H23FN2O6
Molecular Weight: 316.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ccco1)C1CCN(Cc2ccc(F)cc2)CC1.O=C(O)C(=O)O
Standard InChI: InChI=1S/C18H21FN2O2.C2H2O4/c19-16-5-3-14(4-6-16)13-21-9-7-15(8-10-21)18(22)20-12-17-2-1-11-23-17;3-1(4)2(5)6/h1-6,11,15H,7-10,12-13H2,(H,20,22);(H,3,4)(H,5,6)
Standard InChI Key: OOHQIDCESBLDCO-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
6.1944 0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5444 -0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1944 -0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5444 0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7819 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9569 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7085 4.2596 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5313 -3.2378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8638 -0.2779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9940 0.5471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1494 -1.5154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4349 -0.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1494 -0.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2796 -0.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4349 0.5471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7085 1.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9940 -0.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2796 0.9596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7085 0.9596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8638 -2.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9940 2.1971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4230 2.1971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8638 -1.9279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7085 3.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9940 3.0221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4230 3.0221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1964 -3.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2763 -4.0224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4513 -4.0224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
2 6 2 0
3 5 1 0
4 6 1 0
5 6 1 0
7 24 1 0
8 20 1 0
8 28 1 0
9 13 2 0
10 17 1 0
10 18 1 0
10 19 1 0
11 13 1 0
11 23 1 0
12 13 1 0
12 14 1 0
12 15 1 0
14 17 1 0
15 18 1 0
16 19 1 0
16 21 2 0
16 22 1 0
20 23 1 0
20 27 2 0
21 25 1 0
22 26 2 0
24 25 2 0
24 26 1 0
27 29 1 0
28 29 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 316.38Molecular Weight (Monoisotopic): 316.1587AlogP: 2.95#Rotatable Bonds: 5Polar Surface Area: 45.48Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.41CX Basic pKa: 8.12CX LogP: 2.33CX LogD: 1.54Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.92Np Likeness Score: -2.14
References 1. PubChem BioAssay data set,