(Z)-6-[(1R,2S)-2-Azepan-1-yl-5-(4'-carbamoyl-biphenyl-4-ylmethoxy)-cyclopentyloxy]-hex-4-enoic acid

ID: ALA159927

PubChem CID: 44374514

Max Phase: Preclinical

Molecular Formula: C31H40N2O5

Molecular Weight: 520.67

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  NC(=O)c1ccc(-c2ccc(COC3CC[C@H](N4CCCCCC4)[C@H]3OC/C=C\CCC(=O)O)cc2)cc1

Standard InChI:  InChI=1S/C31H40N2O5/c32-31(36)26-15-13-25(14-16-26)24-11-9-23(10-12-24)22-38-28-18-17-27(33-19-5-1-2-6-20-33)30(28)37-21-7-3-4-8-29(34)35/h3,7,9-16,27-28,30H,1-2,4-6,8,17-22H2,(H2,32,36)(H,34,35)/b7-3-/t27-,28?,30+/m0/s1

Standard InChI Key:  UKRDXVRUKWOQIJ-DAJBAZATSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  1  0  0  0  0  0999 V2000
    1.6792   -2.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5000   -1.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2667   -3.2917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3792   -0.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9750   -3.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6792   -1.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5542   -0.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4542   -2.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9292   -0.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1125   -0.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2542   -1.1167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8042   -0.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3542   -2.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1167   -2.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1417    0.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1542   -1.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3292    0.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3375   -1.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7000    0.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7125   -1.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5917   -1.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4542   -1.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7875    0.4333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2917   -1.6875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6542   -0.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4792   -0.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3542   -3.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8917   -1.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8792    0.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -4.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0375   -3.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9667   -2.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8917   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9542   -2.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4375   -4.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7375   -3.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -4.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8375   -4.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  1
  4  7  1  0
  5  1  1  0
  6  2  1  0
  7 16  2  0
  8 33  1  0
  9 10  1  0
 10 19  2  0
 11  6  1  0
 12  4  2  0
 13  5  1  0
 14  8  2  0
 15 17  2  0
 16 18  1  0
 17  9  1  0
 18  9  2  0
 19 29  1  0
 20 28  2  0
 21 32  1  0
 22 21  2  0
 23  4  1  0
  2 24  1  6
 25 11  1  0
 26 25  1  0
 27  8  1  0
 28 26  1  0
 29 26  2  0
 30  3  1  0
 31  3  1  0
 32 24  1  0
 33 34  1  0
 34 22  1  0
 35 30  1  0
 36 31  1  0
 37 35  1  0
 38 36  1  0
  6 13  1  0
 38 37  1  0
 20 10  1  0
  7 15  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA159927

   (Z)-6-[(1R,2S)-2-(azepan-1-yl)-5-[[4-(4-carbamoylphenyl)phenyl]methoxy]cyclopentyl]oxyhex-4-enoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 520.67

Molecular Weight (Monoisotopic): 520.2937

AlogP: 5.18

#Rotatable Bonds: 12

Polar Surface Area: 102.09

Molecular Species: ZWITTERION

HBA: 5

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 7

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 3.79

CX Basic pKa: 10.12

CX LogP: 2.15

CX LogD: 2.15

Aromatic Rings: 2

Heavy Atoms: 38

QED Weighted: 0.37

Np Likeness Score: 0.45

References

1. Campbell I, Collington E, Finch H, Hallett P, Hayes R, Lumley P, Mills K, Wallis C, White B.  (1991)  Synthesis and pharmacological evaluation of novel Amino-prostanoids: potent and orally effective thromboxane A2 receptor antagonists,  1  (12): [10.1016/S0960-894X(01)81049-0]

Source

Source(1):

• Scientific Literature