The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID56422520 ID: ALA1599569
PubChem CID: 25102434
Max Phase: Preclinical
Molecular Formula: C20H19FN4O7S
Molecular Weight: 478.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)Nc1ccc2[nH]c(O)nc2c1
Standard InChI: InChI=1S/C20H19FN4O7S/c21-14-3-1-12(9-17(14)33(29,30)25-5-7-31-8-6-25)19(27)32-11-18(26)22-13-2-4-15-16(10-13)24-20(28)23-15/h1-4,9-10H,5-8,11H2,(H,22,26)(H2,23,24,28)
Standard InChI Key: DIGNRHRGKMDSPW-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-6.4933 -1.5260 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.9222 -0.7010 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.6683 -1.5260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.3183 -1.5260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3499 0.5365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4933 -4.0010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0643 1.7740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0315 0.1240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9209 -0.2885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4933 -2.3510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7216 0.7915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7216 -0.5434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2065 0.9490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4933 -0.7010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2078 -0.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7788 -0.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7788 0.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2078 0.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4933 0.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2078 -2.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7788 -2.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0643 0.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0630 0.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0630 -0.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4920 0.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7775 0.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2065 0.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7775 -0.7010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2078 -3.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7788 -3.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4920 -0.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9209 0.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6354 0.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 2 0
1 4 2 0
1 10 1 0
1 14 1 0
2 15 1 0
5 22 1 0
5 33 1 0
6 29 1 0
6 30 1 0
7 22 2 0
8 27 1 0
9 32 2 0
10 20 1 0
10 21 1 0
11 23 1 0
11 27 2 0
12 24 1 0
12 27 1 0
13 25 1 0
13 32 1 0
14 15 1 0
14 16 2 0
15 18 2 0
16 17 1 0
17 19 2 0
17 22 1 0
18 19 1 0
20 29 1 0
21 30 1 0
23 24 1 0
23 26 2 0
24 28 2 0
25 26 1 0
25 31 2 0
28 31 1 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.46Molecular Weight (Monoisotopic): 478.0958AlogP: 1.22#Rotatable Bonds: 6Polar Surface Area: 150.92Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.43CX Basic pKa: 3.30CX LogP: 1.53CX LogD: 1.53Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -2.29
References 1. PubChem BioAssay data set,