The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24798958 ID: ALA1601178
PubChem CID: 16190629
Max Phase: Preclinical
Molecular Formula: C25H35N5O2
Molecular Weight: 437.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(CNC(=O)CCC2CCCN(c3cc(C)nc(N4CCCC4)n3)C2)c1
Standard InChI: InChI=1S/C25H35N5O2/c1-19-15-23(28-25(27-19)29-12-3-4-13-29)30-14-6-8-20(18-30)10-11-24(31)26-17-21-7-5-9-22(16-21)32-2/h5,7,9,15-16,20H,3-4,6,8,10-14,17-18H2,1-2H3,(H,26,31)
Standard InChI Key: OODPIASNBQPUTF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
5.1277 -3.7470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8409 -2.9220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7314 -4.1595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4459 -2.9220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1604 -1.6845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8748 -2.9220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5554 -4.1595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4459 -3.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1604 -2.5095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1604 -4.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8748 -3.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0170 -3.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3025 -4.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7314 -4.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8278 -1.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4929 -1.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3025 -4.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0170 -5.3970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5729 -0.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7479 -0.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5880 -3.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5893 -4.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1265 -4.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9843 -4.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8409 -3.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4133 -4.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6988 -3.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2699 -3.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9843 -4.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4133 -4.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6988 -5.3970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8422 -4.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 26 1 0
1 32 1 0
2 25 2 0
3 8 1 0
3 12 1 0
3 14 1 0
4 8 1 0
4 9 2 0
5 9 1 0
5 15 1 0
5 16 1 0
6 9 1 0
6 11 2 0
7 25 1 0
7 28 1 0
8 10 2 0
10 11 1 0
11 22 1 0
12 13 1 0
13 17 1 0
13 21 1 0
14 18 1 0
15 19 1 0
16 20 1 0
17 18 1 0
19 20 1 0
21 23 1 0
23 25 1 0
24 27 2 0
24 28 1 0
24 29 1 0
26 27 1 0
26 30 2 0
29 31 2 0
30 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.59Molecular Weight (Monoisotopic): 437.2791AlogP: 3.71#Rotatable Bonds: 8Polar Surface Area: 70.59Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.65CX LogP: 3.84CX LogD: 3.41Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.68Np Likeness Score: -1.61
References 1. PubChem BioAssay data set,