The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID85270435 ID: ALA1601208
Cas Number: 875162-73-5
PubChem CID: 16274036
Max Phase: Preclinical
Molecular Formula: C24H24N2O6
Molecular Weight: 436.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(OC)c(NC(=O)COC(=O)COc2ccc(Nc3ccccc3)cc2)c1
Standard InChI: InChI=1S/C24H24N2O6/c1-29-20-12-13-22(30-2)21(14-20)26-23(27)15-32-24(28)16-31-19-10-8-18(9-11-19)25-17-6-4-3-5-7-17/h3-14,25H,15-16H2,1-2H3,(H,26,27)
Standard InChI Key: MZGWOEIXFCVYRZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
2.5972 -2.2979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 -5.5979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1185 -3.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9751 -3.5354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4538 -4.3604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6896 -2.2979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1683 -3.1229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.9764 -4.7729 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8828 -3.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 -3.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8828 -4.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 -4.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3117 -3.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3117 -4.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4538 -3.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2619 -4.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8330 -3.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2619 -3.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5475 -4.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5475 -3.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8330 -4.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2606 -3.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6909 -4.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6896 -3.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4041 -3.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4054 -4.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6909 -3.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3117 -1.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3117 -6.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1198 -4.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4054 -3.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1198 -3.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 10 1 0
1 28 1 0
2 12 1 0
2 29 1 0
3 17 1 0
3 25 1 0
4 22 1 0
4 24 1 0
5 15 2 0
6 24 2 0
7 9 1 0
7 15 1 0
8 16 1 0
8 23 1 0
9 10 1 0
9 11 2 0
10 13 2 0
11 12 1 0
12 14 2 0
13 14 1 0
15 22 1 0
16 18 2 0
16 19 1 0
17 20 2 0
17 21 1 0
18 20 1 0
19 21 2 0
23 26 2 0
23 27 1 0
24 25 1 0
26 30 1 0
27 31 2 0
30 32 2 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.46Molecular Weight (Monoisotopic): 436.1634AlogP: 4.01#Rotatable Bonds: 10Polar Surface Area: 95.12Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.43CX Basic pKa: 1.77CX LogP: 3.48CX LogD: 3.48Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -1.21
References 1. PubChem BioAssay data set,