The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID3714518 ID: ALA1601573
PubChem CID: 2526863
Max Phase: Preclinical
Molecular Formula: C22H20N4O3S
Molecular Weight: 420.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1NC(=O)Cc1noc(CSc2cc(C)c3ccccc3n2)n1
Standard InChI: InChI=1S/C22H20N4O3S/c1-14-11-22(24-16-8-4-3-7-15(14)16)30-13-21-25-19(26-29-21)12-20(27)23-17-9-5-6-10-18(17)28-2/h3-11H,12-13H2,1-2H3,(H,23,27)
Standard InChI Key: LGCFFMPQJCFESL-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-2.8186 -0.8207 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.2868 0.0812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5823 2.2487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4564 2.7437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3897 -0.8207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6193 1.2373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8388 0.6943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6125 3.5836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6752 -2.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6752 -1.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3897 -2.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1041 -1.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1041 -2.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5331 0.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4263 1.4088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0393 -2.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0393 -0.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8186 0.0043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4330 3.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7618 2.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2769 2.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9179 3.0024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7538 -2.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7538 -1.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3897 -3.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7685 4.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7384 3.0886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5890 4.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0739 3.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0672 1.5813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 12 1 0
1 18 1 0
2 7 1 0
2 14 1 0
3 22 1 0
3 30 1 0
4 21 2 0
5 10 2 0
5 12 1 0
6 14 2 0
6 15 1 0
7 15 2 0
8 19 1 0
8 21 1 0
9 10 1 0
9 11 2 0
9 16 1 0
10 17 1 0
11 13 1 0
11 25 1 0
12 13 2 0
14 18 1 0
15 20 1 0
16 23 2 0
17 24 2 0
19 22 1 0
19 26 2 0
20 21 1 0
22 27 2 0
23 24 1 0
26 28 1 0
27 29 1 0
28 29 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.49Molecular Weight (Monoisotopic): 420.1256AlogP: 4.41#Rotatable Bonds: 7Polar Surface Area: 90.14Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.24CX Basic pKa: 3.55CX LogP: 4.92CX LogD: 4.92Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.44Np Likeness Score: -2.09
References 1. PubChem BioAssay data set, 2. PubChem BioAssay data set,