The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID17388846 ID: ALA1602127
Cas Number: 542-40-5
PubChem CID: 5281249
Max Phase: Preclinical
Molecular Formula: C24H28O4
Molecular Weight: 380.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(/C=C/C=C(C)/C=C/C(=O)O)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C(=O)O
Standard InChI: InChI=1S/C24H28O4/c1-19(11-7-13-21(3)15-17-23(25)26)9-5-6-10-20(2)12-8-14-22(4)16-18-24(27)28/h5-18H,1-4H3,(H,25,26)(H,27,28)/b6-5+,11-7+,12-8+,17-15+,18-16+,19-9+,20-10+,21-13+,22-14+
Standard InChI Key: ZVKOASAVGLETCT-UOGKPENDSA-N
Molfile:
RDKit 2D
28 27 0 0 0 0 0 0 0 0999 V2000
14.1434 2.5168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1809 -5.3424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9059 3.2313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9434 -4.6279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6684 1.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4184 -3.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1934 -0.3411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8934 -1.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8434 1.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2434 -3.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6059 0.3734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4809 -2.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0809 1.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0059 -3.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4309 0.3734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6559 -2.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3684 -0.3411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7184 -1.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9559 -1.0555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1309 -1.0555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9059 1.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1809 -3.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3184 2.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7684 -4.6279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0809 0.3734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0059 -2.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6059 -1.0555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4809 -1.0555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 23 2 0
2 24 2 0
3 23 1 0
4 24 1 0
5 9 2 0
5 13 1 0
5 25 1 0
6 10 2 0
6 14 1 0
6 26 1 0
7 11 1 0
7 17 2 0
7 27 1 0
8 12 1 0
8 18 2 0
8 28 1 0
9 15 1 0
10 16 1 0
11 15 2 0
12 16 2 0
13 21 2 0
14 22 2 0
17 19 1 0
18 20 1 0
19 20 2 0
21 23 1 0
22 24 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 380.48Molecular Weight (Monoisotopic): 380.1988AlogP: 5.72#Rotatable Bonds: 10Polar Surface Area: 74.60Molecular Species: ACIDHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.47CX Basic pKa: ┄CX LogP: 5.15CX LogD: -0.01Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.38Np Likeness Score: 0.94
References 1. PubChem BioAssay data set,