SID17458783

ID: ALA1603145

PubChem CID: 4293570

Max Phase: Preclinical

Molecular Formula: C16H16N2O2S

Molecular Weight: 300.38

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)C(Cc1ccccc1)NC(=S)Nc1ccccc1

Standard InChI:  InChI=1S/C16H16N2O2S/c19-15(20)14(11-12-7-3-1-4-8-12)18-16(21)17-13-9-5-2-6-10-13/h1-10,14H,11H2,(H,19,20)(H2,17,18,21)

Standard InChI Key:  OPPVUBSIFDPEHQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
    0.5538   -0.0490    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2712   -0.0490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5087    0.6655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5538    1.3799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7913    0.6655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2712    1.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9663    0.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6837    2.0944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5087    2.0944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6837    0.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2038   -0.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9212    1.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9212    2.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0288   -0.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7913   -0.7635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7462    1.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7462    2.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4413   -0.7635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2038   -1.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1587    2.0944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0288   -1.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  7  2  0
  2 10  2  0
  3 10  1  0
  4  6  1  0
  4  7  1  0
  5  7  1  0
  5 11  1  0
  6  8  1  0
  6 10  1  0
  8  9  1  0
  9 12  2  0
  9 13  1  0
 11 14  2  0
 11 15  1  0
 12 16  1  0
 13 17  2  0
 14 18  1  0
 15 19  2  0
 16 20  2  0
 17 20  1  0
 18 21  2  0
 19 21  1  0
M  END

Alternative Forms

Associated Targets(Human)

DUSP3 Tchem Dual specificity protein phosphatase 3 (1161 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 300.38Molecular Weight (Monoisotopic): 300.0932AlogP: 2.67#Rotatable Bonds: 5
Polar Surface Area: 61.36Molecular Species: ACIDHBA: 2HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 4.18CX Basic pKa: CX LogP: 3.69CX LogD: 0.65
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.74Np Likeness Score: -0.86

References

1. PubChem BioAssay data set, 

Source

Source(1):