The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 4-[4-[4-carboxy-3-hydroxyanilino(thioxo)methylamino]anilino(thioxo)methylamino]-2-hydroxybenzoic acid ID: ALA160315
PubChem CID: 44373186
Max Phase: Preclinical
Molecular Formula: C26H26N4O6S2
Molecular Weight: 554.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(/N=C(\S)Nc2ccc(/N=C(/S)Nc3ccc(C(=O)OCC)c(O)c3)cc2)cc1O
Standard InChI: InChI=1S/C26H26N4O6S2/c1-3-35-23(33)19-11-9-17(13-21(19)31)29-25(37)27-15-5-7-16(8-6-15)28-26(38)30-18-10-12-20(22(32)14-18)24(34)36-4-2/h5-14,31-32H,3-4H2,1-2H3,(H2,27,29,37)(H2,28,30,38)
Standard InChI Key: BBDTZWJCLCJOJN-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
4.7500 -5.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0292 1.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1792 0.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2542 -3.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0375 0.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5875 -4.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7417 1.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5292 -5.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8042 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3250 0.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1250 -5.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3125 1.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4125 -4.2750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8917 0.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4667 -3.1917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4667 0.1083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8750 -2.9250 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.1792 1.3458 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1917 -4.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6125 0.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7417 2.5958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6875 -6.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4667 -0.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4667 -2.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3417 -5.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6042 1.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7542 0.1208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2042 -3.7167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4625 1.3583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1500 -4.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1875 -1.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7542 -1.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7542 -1.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1875 -1.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1750 1.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9292 -5.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8917 1.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5542 -4.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 12 2 0
3 16 2 0
4 13 2 0
5 10 2 0
6 1 2 0
7 2 1 0
8 1 1 0
9 6 1 0
10 20 1 0
11 1 1 0
12 26 1 0
13 19 1 0
14 3 1 0
15 4 1 0
16 23 1 0
17 4 1 0
18 3 1 0
19 25 1 0
20 14 1 0
21 7 2 0
22 8 2 0
23 31 2 0
24 15 1 0
25 11 2 0
26 20 2 0
27 5 1 0
28 6 1 0
29 7 1 0
30 8 1 0
31 34 1 0
32 24 1 0
33 32 2 0
34 24 2 0
35 29 1 0
36 30 1 0
37 35 1 0
38 36 1 0
19 9 2 0
33 23 1 0
2 5 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.65Molecular Weight (Monoisotopic): 554.1294AlogP: 5.51#Rotatable Bonds: 8Polar Surface Area: 141.84Molecular Species: ZWITTERIONHBA: 8HBD: 6#RO5 Violations: 3HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: -0.54CX Basic pKa: 14.90CX LogP: 9.27CX LogD: 8.55Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.09Np Likeness Score: -0.64
References 1. Phuong T, Khac-Minh T, Van Ha NT, Ngoc Phuong HT.. (2004) Synthesis and antifungal activities of phenylenedithioureas., 14 (3): [PMID:14741262 ] [10.1016/j.bmcl.2003.11.044 ]