The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID51085465 ID: ALA1603215
Cas Number: 899991-55-0
PubChem CID: 18580945
Max Phase: Preclinical
Molecular Formula: C22H27FN4O4S
Molecular Weight: 462.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)N(CC(=O)NCc2ccc(F)cc2)C(=O)N2CCN(C)CC2)cc1
Standard InChI: InChI=1S/C22H27FN4O4S/c1-17-3-9-20(10-4-17)32(30,31)27(22(29)26-13-11-25(2)12-14-26)16-21(28)24-15-18-5-7-19(23)8-6-18/h3-10H,11-16H2,1-2H3,(H,24,28)
Standard InChI Key: NECWHFNXGDYHEP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-3.3202 -0.0153 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1100 1.2222 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.9077 0.6992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7327 -0.7297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8913 -1.6653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1768 -1.2528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6058 -0.4278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3202 -1.6653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7492 -2.4903 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4624 -0.0153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0347 0.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6058 -1.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8913 -0.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7492 -0.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0347 1.2222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1768 -0.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3202 -2.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0347 -1.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4637 0.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7492 1.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4637 1.2222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0347 -2.9028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7492 -1.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2521 -0.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9666 -0.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1781 1.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4637 -2.9028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9666 0.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6811 -0.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3955 0.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6811 1.2222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3955 -0.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 2 0
1 4 2 0
1 7 1 0
1 11 1 0
2 30 1 0
5 12 2 0
6 16 2 0
7 12 1 0
7 13 1 0
8 12 1 0
8 17 1 0
8 18 1 0
9 22 1 0
9 23 1 0
9 27 1 0
10 16 1 0
10 24 1 0
11 14 2 0
11 15 1 0
13 16 1 0
14 19 1 0
15 20 2 0
17 22 1 0
18 23 1 0
19 21 2 0
20 21 1 0
21 26 1 0
24 25 1 0
25 28 2 0
25 29 1 0
28 31 1 0
29 32 2 0
30 31 2 0
30 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.55Molecular Weight (Monoisotopic): 462.1737AlogP: 1.81#Rotatable Bonds: 6Polar Surface Area: 90.03Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.79CX Basic pKa: 6.32CX LogP: 2.03CX LogD: 1.99Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.71Np Likeness Score: -1.70
References 1. PubChem BioAssay data set,