The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID49645902 ID: ALA1603426
Cas Number: 637753-28-7
PubChem CID: 6065235
Max Phase: Preclinical
Molecular Formula: C25H29NO5
Molecular Weight: 423.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2c(C)oc3c(CN4CCCC(C)C4)c(O)ccc3c2=O)cc1OC
Standard InChI: InChI=1S/C25H29NO5/c1-15-6-5-11-26(13-15)14-19-20(27)9-8-18-24(28)23(16(2)31-25(18)19)17-7-10-21(29-3)22(12-17)30-4/h7-10,12,15,27H,5-6,11,13-14H2,1-4H3
Standard InChI Key: KMVXTAKCDMFHMQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-0.6753 -0.8264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6753 1.6486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1826 -0.8264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2477 0.4111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2477 2.0611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4681 -2.0639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0392 -0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0392 0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3898 0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6753 0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7536 -0.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3898 -0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1043 0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4681 -0.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7536 0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4681 0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7536 -1.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8187 0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1043 1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5332 0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5332 1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1043 -0.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8187 2.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1826 -1.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4681 -2.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8970 -2.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1826 -3.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8970 -2.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9621 0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9621 1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6115 -1.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 7 1 0
1 12 1 0
2 10 2 0
3 14 1 0
4 20 1 0
4 29 1 0
5 21 1 0
5 30 1 0
6 17 1 0
6 24 1 0
6 25 1 0
7 8 1 0
7 11 2 0
8 10 1 0
8 15 2 0
9 10 1 0
9 12 2 0
9 13 1 0
11 14 1 0
11 17 1 0
12 22 1 0
13 18 1 0
13 19 2 0
14 16 2 0
15 16 1 0
18 20 2 0
19 23 1 0
20 21 1 0
21 23 2 0
24 26 1 0
25 27 1 0
26 28 1 0
26 31 1 0
27 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.51Molecular Weight (Monoisotopic): 423.2046AlogP: 4.72#Rotatable Bonds: 5Polar Surface Area: 72.14Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.31CX Basic pKa: 8.39CX LogP: 2.73CX LogD: 2.72Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -0.14
References 1. PubChem BioAssay data set,