SID26756250

ID: ALA1603460

PubChem CID: 9548953

Max Phase: Preclinical

Molecular Formula: C26H24N4O2

Molecular Weight: 424.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H]1Cc2c(-c3ccccc3)nc3c(c2CO1)CN(C(=O)Nc1cccc(C#N)c1)CC3

Standard InChI:  InChI=1S/C26H24N4O2/c1-17-12-21-23(16-32-17)22-15-30(26(31)28-20-9-5-6-18(13-20)14-27)11-10-24(22)29-25(21)19-7-3-2-4-8-19/h2-9,13,17H,10-12,15-16H2,1H3,(H,28,31)/t17-/m0/s1

Standard InChI Key:  HKVGNLHGQBWJCK-KRWDZBQOSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  1  0  0  0  0  0999 V2000
    6.9301    2.2596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6301    0.8306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8676    4.4030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6301    2.2596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3926    1.5451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8051   -2.0273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6926    2.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8676    2.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1051    3.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6926    4.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4551    3.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4551    2.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1051    5.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9301    3.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1051    2.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6301    3.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3426    2.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2176    2.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2176    1.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6926    5.8319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9301    5.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9801    0.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1676    2.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1051    6.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3426    5.8319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9301    6.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3926    0.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1551    0.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9801   -0.5983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7426    0.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1551   -0.5983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3926   -1.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 15  1  0
  1 17  1  0
  2 19  2  0
  3 10  1  0
  3 11  2  0
  4 12  1  0
  4 18  1  0
  4 19  1  0
  5 19  1  0
  5 22  1  0
  6 32  3  0
  7  8  2  0
  7  9  1  0
  7 15  1  0
  8 11  1  0
  8 12  1  0
  9 10  2  0
  9 14  1  0
 10 13  1  0
 11 16  1  0
 13 20  2  0
 13 21  1  0
 14 17  1  0
 16 18  1  0
 17 23  1  6
 20 24  1  0
 21 25  2  0
 22 27  1  0
 22 28  2  0
 24 26  2  0
 25 26  1  0
 27 29  2  0
 28 30  1  0
 29 31  1  0
 29 32  1  0
 30 31  2  0
M  END

Associated Targets(Human)

RECQL Tbio ATP-dependent DNA helicase Q1 (5575 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.50Molecular Weight (Monoisotopic): 424.1899AlogP: 4.67#Rotatable Bonds: 2
Polar Surface Area: 78.25Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.03CX Basic pKa: 3.79CX LogP: 4.12CX LogD: 4.12
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -1.26

References

1. PubChem BioAssay data set, 

Source

Source(1):