The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID26756250 ID: ALA1603460
PubChem CID: 9548953
Max Phase: Preclinical
Molecular Formula: C26H24N4O2
Molecular Weight: 424.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1Cc2c(-c3ccccc3)nc3c(c2CO1)CN(C(=O)Nc1cccc(C#N)c1)CC3
Standard InChI: InChI=1S/C26H24N4O2/c1-17-12-21-23(16-32-17)22-15-30(26(31)28-20-9-5-6-18(13-20)14-27)11-10-24(22)29-25(21)19-7-3-2-4-8-19/h2-9,13,17H,10-12,15-16H2,1H3,(H,28,31)/t17-/m0/s1
Standard InChI Key: HKVGNLHGQBWJCK-KRWDZBQOSA-N
Molfile:
RDKit 2D
32 36 0 0 1 0 0 0 0 0999 V2000
6.9301 2.2596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6301 0.8306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8676 4.4030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6301 2.2596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3926 1.5451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8051 -2.0273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6926 2.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8676 2.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1051 3.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6926 4.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4551 3.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4551 2.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1051 5.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9301 3.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1051 2.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6301 3.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3426 2.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2176 2.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2176 1.5451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6926 5.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9301 5.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9801 0.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1676 2.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1051 6.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3426 5.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9301 6.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3926 0.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1551 0.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9801 -0.5983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7426 0.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1551 -0.5983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3926 -1.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 15 1 0
1 17 1 0
2 19 2 0
3 10 1 0
3 11 2 0
4 12 1 0
4 18 1 0
4 19 1 0
5 19 1 0
5 22 1 0
6 32 3 0
7 8 2 0
7 9 1 0
7 15 1 0
8 11 1 0
8 12 1 0
9 10 2 0
9 14 1 0
10 13 1 0
11 16 1 0
13 20 2 0
13 21 1 0
14 17 1 0
16 18 1 0
17 23 1 6
20 24 1 0
21 25 2 0
22 27 1 0
22 28 2 0
24 26 2 0
25 26 1 0
27 29 2 0
28 30 1 0
29 31 1 0
29 32 1 0
30 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.50Molecular Weight (Monoisotopic): 424.1899AlogP: 4.67#Rotatable Bonds: 2Polar Surface Area: 78.25Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.03CX Basic pKa: 3.79CX LogP: 4.12CX LogD: 4.12Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -1.26
References 1. PubChem BioAssay data set,