The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID4249415 ID: ALA1603542
PubChem CID: 3243373
Max Phase: Preclinical
Molecular Formula: C24H22N4O3S
Molecular Weight: 446.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc2c(=O)n(Cc3ccco3)c(=S)[nH]c2c1)N1CCN(c2ccccc2)CC1
Standard InChI: InChI=1S/C24H22N4O3S/c29-22(27-12-10-26(11-13-27)18-5-2-1-3-6-18)17-8-9-20-21(15-17)25-24(32)28(23(20)30)16-19-7-4-14-31-19/h1-9,14-15H,10-13,16H2,(H,25,32)
Standard InChI Key: KUVYCHRDFZKBHJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-3.5853 2.4166 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.1564 -0.0584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7015 3.2416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3860 1.9996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8708 1.1791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1564 2.4166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4160 2.0041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8449 1.1791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4419 1.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4419 2.0041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1564 0.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8708 2.0041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0130 2.0041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7274 2.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7274 0.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7015 2.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0130 1.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5853 0.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2998 1.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1305 2.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4160 1.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8449 2.0041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1305 0.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5594 0.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0535 0.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1930 2.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6055 1.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2739 1.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5594 -0.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9883 0.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2739 -0.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9883 -0.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 12 2 0
2 11 2 0
3 16 2 0
4 19 1 0
4 26 1 0
5 11 1 0
5 12 1 0
5 18 1 0
6 10 1 0
6 12 1 0
7 16 1 0
7 20 1 0
7 21 1 0
8 22 1 0
8 23 1 0
8 24 1 0
9 10 1 0
9 11 1 0
9 15 2 0
10 14 2 0
13 14 1 0
13 16 1 0
13 17 2 0
15 17 1 0
18 19 1 0
19 25 2 0
20 22 1 0
21 23 1 0
24 28 2 0
24 29 1 0
25 27 1 0
26 27 2 0
28 30 1 0
29 31 2 0
30 32 2 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.53Molecular Weight (Monoisotopic): 446.1413AlogP: 3.66#Rotatable Bonds: 4Polar Surface Area: 74.48Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.90CX Basic pKa: 3.42CX LogP: 4.33CX LogD: 3.78Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.84
References 1. PubChem BioAssay data set,