The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID11111947 ID: ALA1603665
PubChem CID: 6604037
Max Phase: Preclinical
Molecular Formula: C22H35NO3
Molecular Weight: 361.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC/C=C\C[C@H](O)/C=C\c1cccc(C[C@H](O)CCCCO)n1
Standard InChI: InChI=1S/C22H35NO3/c1-2-3-4-5-6-7-13-21(25)16-15-19-11-10-12-20(23-19)18-22(26)14-8-9-17-24/h6-7,10-12,15-16,21-22,24-26H,2-5,8-9,13-14,17-18H2,1H3/b7-6-,16-15-/t21-,22+/m0/s1
Standard InChI Key: JNBOAUIJLDEICX-YVRJFAEXSA-N
Molfile:
RDKit 2D
26 26 0 0 1 0 0 0 0 0999 V2000
2.1128 0.4638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4595 0.0513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6852 1.7013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0306 1.7013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6839 1.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7451 1.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6839 0.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3984 1.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7451 0.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4595 1.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0306 0.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1128 1.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1740 1.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1740 0.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8273 1.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8885 0.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5418 1.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6029 0.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2562 1.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3174 0.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9707 1.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3174 -0.7737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0319 -1.1862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0319 -2.0112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7464 -2.4237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7464 -3.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 1 1 1
14 2 1 1
3 21 1 0
4 5 1 0
4 6 2 0
5 7 2 0
5 8 1 0
6 9 1 0
6 10 1 0
7 11 1 0
8 12 1 0
9 11 2 0
10 13 2 0
12 15 1 0
13 14 1 0
14 16 1 0
15 17 1 0
16 18 1 0
17 19 1 0
18 20 2 0
19 21 1 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 361.53Molecular Weight (Monoisotopic): 361.2617AlogP: 4.05#Rotatable Bonds: 14Polar Surface Area: 73.58Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.83CX LogP: 4.02CX LogD: 4.02Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.35Np Likeness Score: 1.30
References 1. PubChem BioAssay data set,