The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24395602 ID: ALA1603765
Cas Number: 902881-95-2
PubChem CID: 16017693
Max Phase: Preclinical
Molecular Formula: C26H24N6O2S
Molecular Weight: 484.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)cc(NC(=O)CSc2nc3nccnc3c(=O)n2CCc2c[nH]c3ccccc23)c1
Standard InChI: InChI=1S/C26H24N6O2S/c1-16-11-17(2)13-19(12-16)30-22(33)15-35-26-31-24-23(27-8-9-28-24)25(34)32(26)10-7-18-14-29-21-6-4-3-5-20(18)21/h3-6,8-9,11-14,29H,7,10,15H2,1-2H3,(H,30,33)
Standard InChI Key: PLFAKGYVIQSWOG-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
6.8921 -4.6058 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.1741 -3.7227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3822 -6.1751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5331 -4.1642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8302 -5.5620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6642 -5.2919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7683 -6.5181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4909 -0.6470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7412 -6.6166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4712 -5.1204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7261 -4.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0232 -5.7335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0851 -4.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7880 -3.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4909 -1.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2755 -1.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2360 -2.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2755 -0.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4093 -6.0765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9613 -6.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0060 -1.3145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4441 -5.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9900 -2.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9900 -0.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1892 -6.0035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7045 -1.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7045 -0.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4863 -7.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0383 -8.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6793 -7.5728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7834 -8.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4244 -8.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9764 -8.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3354 -9.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6174 -8.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 13 1 0
1 22 1 0
2 11 2 0
3 25 2 0
4 11 1 0
4 13 1 0
4 14 1 0
5 12 1 0
5 13 2 0
6 10 1 0
6 19 2 0
7 12 1 0
7 20 2 0
8 18 1 0
8 21 1 0
9 25 1 0
9 28 1 0
10 11 1 0
10 12 2 0
14 17 1 0
15 16 1 0
15 17 1 0
15 21 2 0
16 18 2 0
16 23 1 0
18 24 1 0
19 20 1 0
22 25 1 0
23 26 2 0
24 27 2 0
26 27 1 0
28 29 2 0
28 30 1 0
29 31 1 0
30 32 2 0
31 33 2 0
31 34 1 0
32 33 1 0
32 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.59Molecular Weight (Monoisotopic): 484.1681AlogP: 4.26#Rotatable Bonds: 7Polar Surface Area: 105.56Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.67CX Basic pKa: ┄CX LogP: 4.66CX LogD: 4.66Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -1.68
References 1. PubChem BioAssay data set,