The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24274839 ID: ALA1604193
PubChem CID: 4642830
Max Phase: Preclinical
Molecular Formula: C27H25N5O3
Molecular Weight: 467.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C2C(C(=O)Nc3ccccc3)=C(C)Nc3nc(-c4ccccc4)nn32)cc1OC
Standard InChI: InChI=1S/C27H25N5O3/c1-17-23(26(33)29-20-12-8-5-9-13-20)24(19-14-15-21(34-2)22(16-19)35-3)32-27(28-17)30-25(31-32)18-10-6-4-7-11-18/h4-16,24H,1-3H3,(H,29,33)(H,28,30,31)
Standard InChI Key: YRWDSSCAZDLGSA-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-1.2003 3.2639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7727 6.1514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3438 6.9764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0582 3.2639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8429 3.5189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3438 2.0264 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8429 2.1840 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9148 4.5014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3438 3.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6293 3.2639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0582 2.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3438 4.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6293 2.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3278 2.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9148 3.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1528 2.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0582 4.9139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6293 4.9139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0582 5.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3438 6.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9148 2.0264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6293 5.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5653 2.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5653 3.5659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2003 4.9139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3903 2.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3903 3.5659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2003 5.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4859 4.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8028 2.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7727 6.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4859 6.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2286 4.9139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6293 7.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2286 5.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 15 2 0
2 19 1 0
2 31 1 0
3 20 1 0
3 34 1 0
4 5 1 0
4 9 1 0
4 11 1 0
5 14 2 0
6 11 1 0
6 13 1 0
7 11 2 0
7 14 1 0
8 15 1 0
8 25 1 0
9 10 1 0
9 12 1 0
10 13 2 0
10 15 1 0
12 17 2 0
12 18 1 0
13 21 1 0
14 16 1 0
16 23 2 0
16 24 1 0
17 19 1 0
18 22 2 0
19 20 2 0
20 22 1 0
23 26 1 0
24 27 2 0
25 28 2 0
25 29 1 0
26 30 2 0
27 30 1 0
28 32 1 0
29 33 2 0
32 35 2 0
33 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.53Molecular Weight (Monoisotopic): 467.1957AlogP: 4.89#Rotatable Bonds: 6Polar Surface Area: 90.30Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.26CX Basic pKa: 1.96CX LogP: 4.59CX LogD: 4.59Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.42Np Likeness Score: -1.41
References 1. PubChem BioAssay data set,