The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID843998 ID: ALA1604258
PubChem CID: 646304
Max Phase: Preclinical
Molecular Formula: C21H20N4O6S2
Molecular Weight: 488.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2nsnc2c1S(=O)(=O)N(CCO)Cc1cc2cc3c(cc2nc1O)OCCO3
Standard InChI: InChI=1S/C21H20N4O6S2/c1-12-2-3-15-19(24-32-23-15)20(12)33(28,29)25(4-5-26)11-14-8-13-9-17-18(31-7-6-30-17)10-16(13)22-21(14)27/h2-3,8-10,26H,4-7,11H2,1H3,(H,22,27)
Standard InChI Key: UOTBVRGDDNJCOW-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-0.1100 1.7316 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.3269 4.2748 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.5225 2.4461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3025 1.0171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.8258 1.7316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.8258 0.0816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5389 0.0816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1100 -0.7434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8245 1.3191 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0086 3.5211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1474 4.1886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9679 0.0816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6045 2.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6045 2.9691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3189 1.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3189 3.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2534 1.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5389 1.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6823 1.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6823 0.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0334 2.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0334 2.9691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2534 0.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9679 1.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1113 1.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1113 0.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8245 0.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3968 1.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3968 0.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3189 0.9066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1100 0.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5402 1.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5402 0.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 2 0
1 4 2 0
1 9 1 0
1 13 1 0
2 10 1 0
2 11 1 0
5 25 1 0
5 32 1 0
6 26 1 0
6 33 1 0
7 23 1 0
8 31 1 0
9 18 1 0
9 27 1 0
10 14 2 0
11 16 2 0
12 20 1 0
12 23 2 0
13 14 1 0
13 15 2 0
14 16 1 0
15 21 1 0
15 30 1 0
16 22 1 0
17 18 1 0
17 23 1 0
17 24 2 0
19 20 1 0
19 24 1 0
19 28 2 0
20 29 2 0
21 22 2 0
25 26 2 0
25 28 1 0
26 29 1 0
27 31 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.55Molecular Weight (Monoisotopic): 488.0824AlogP: 2.21#Rotatable Bonds: 6Polar Surface Area: 134.97Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.47CX Basic pKa: 2.12CX LogP: 2.68CX LogD: 2.68Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -1.55
References 1. PubChem BioAssay data set,