The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID4256642 ID: ALA1604290
PubChem CID: 1297523
Max Phase: Preclinical
Molecular Formula: C23H29N3O4S
Molecular Weight: 443.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1CCN(C(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)CC1
Standard InChI: InChI=1S/C23H29N3O4S/c1-30-22-8-4-3-7-21(22)24-15-17-25(18-16-24)23(27)19-9-11-20(12-10-19)31(28,29)26-13-5-2-6-14-26/h3-4,7-12H,2,5-6,13-18H2,1H3
Standard InChI Key: HEQZKIBJTUEGCD-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
0.1419 -6.2046 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.9669 -6.2046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6831 -6.2046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5726 -2.4921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2853 -0.0171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1419 -7.0296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8564 -2.4921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2853 -1.6671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1419 -5.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1419 -3.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1419 -2.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5726 -4.9671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8564 -4.9671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9998 -1.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5726 -4.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8564 -4.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8564 -1.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5708 -2.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9998 -0.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8564 -7.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5726 -7.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5708 -1.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2853 -2.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7143 -1.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8564 -8.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5726 -8.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7143 -0.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1419 -8.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4287 -1.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4287 -0.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2853 0.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 2 0
1 6 1 0
1 9 1 0
4 11 2 0
5 19 1 0
5 31 1 0
6 20 1 0
6 21 1 0
7 11 1 0
7 17 1 0
7 18 1 0
8 14 1 0
8 22 1 0
8 23 1 0
9 12 2 0
9 13 1 0
10 11 1 0
10 15 2 0
10 16 1 0
12 15 1 0
13 16 2 0
14 19 1 0
14 24 2 0
17 22 1 0
18 23 1 0
19 27 2 0
20 25 1 0
21 26 1 0
24 29 1 0
25 28 1 0
26 28 1 0
27 30 1 0
29 30 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.57Molecular Weight (Monoisotopic): 443.1879AlogP: 2.83#Rotatable Bonds: 5Polar Surface Area: 70.16Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.22CX LogP: 2.76CX LogD: 2.76Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.71Np Likeness Score: -1.76
References 1. PubChem BioAssay data set,