The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24389658 ID: ALA1604420
Cas Number: 831241-10-2
PubChem CID: 2975647
Max Phase: Preclinical
Molecular Formula: C25H29NO4S
Molecular Weight: 439.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2occ(CC(=O)N(Cc3ccc(C(C)C)cc3)C3CCS(=O)(=O)C3)c2c1
Standard InChI: InChI=1S/C25H29NO4S/c1-17(2)20-7-5-19(6-8-20)14-26(22-10-11-31(28,29)16-22)25(27)13-21-15-30-24-9-4-18(3)12-23(21)24/h4-9,12,15,17,22H,10-11,13-14,16H2,1-3H3
Standard InChI Key: PMXFZBONQCTPOC-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
0.4228 -5.4825 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5152 -1.9333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6193 -4.4943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0873 -4.7288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3618 -5.7374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5574 -5.4505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2998 -3.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7504 -5.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5152 -3.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2998 -2.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8123 -4.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2603 -4.0528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1373 -5.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4148 -6.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0303 -2.6007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1094 -6.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5944 -6.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0143 -3.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0143 -1.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8545 -6.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7288 -3.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7288 -2.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4065 -7.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0475 -7.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3446 -8.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1516 -8.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7926 -7.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4433 -3.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0897 -9.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6417 -9.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2827 -9.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 4 2 0
1 5 2 0
1 13 1 0
1 17 1 0
2 10 1 0
2 15 1 0
3 11 2 0
6 8 1 0
6 11 1 0
6 16 1 0
7 9 1 0
7 10 2 0
7 18 1 0
8 13 1 0
8 14 1 0
9 12 1 0
9 15 2 0
10 19 1 0
11 12 1 0
14 17 1 0
16 20 1 0
18 21 2 0
19 22 2 0
20 23 2 0
20 24 1 0
21 22 1 0
21 28 1 0
23 26 1 0
24 27 2 0
25 26 2 0
25 27 1 0
25 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.58Molecular Weight (Monoisotopic): 439.1817AlogP: 4.62#Rotatable Bonds: 6Polar Surface Area: 67.59Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.67CX LogD: 3.67Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.56Np Likeness Score: -1.63
References 1. PubChem BioAssay data set,