The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID4262739 ID: ALA1604423
PubChem CID: 1154509
Max Phase: Preclinical
Molecular Formula: C22H23ClN2O7S
Molecular Weight: 494.95
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(-c2nc(S(=O)(=O)c3ccc(Cl)cc3)c(N3CCOCC3)o2)cc(OC)c1OC
Standard InChI: InChI=1S/C22H23ClN2O7S/c1-28-17-12-14(13-18(29-2)19(17)30-3)20-24-21(22(32-20)25-8-10-31-11-9-25)33(26,27)16-6-4-15(23)5-7-16/h4-7,12-13H,8-11H2,1-3H3
Standard InChI Key: ZUWITVUSFLJSLM-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-2.1677 -1.9864 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.2280 0.6833 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.3368 2.1354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4394 0.1984 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8955 1.1683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7596 5.0953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0983 5.0953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6694 5.9203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5367 -0.6515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0019 2.1354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5668 0.6833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2569 1.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0819 1.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6694 2.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7130 0.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6694 3.4453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0451 3.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3839 3.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0451 4.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3839 4.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6694 5.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3774 -0.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5334 0.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2313 -0.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3873 0.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8623 -1.4052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0184 -0.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6828 -1.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7162 -0.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8722 0.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7596 5.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0983 5.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0451 6.3328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 28 1 0
2 4 2 0
2 5 2 0
2 12 1 0
2 15 1 0
3 13 1 0
3 14 1 0
6 19 1 0
6 31 1 0
7 20 1 0
7 32 1 0
8 21 1 0
8 33 1 0
9 29 1 0
9 30 1 0
10 12 1 0
10 14 2 0
11 13 1 0
11 24 1 0
11 25 1 0
12 13 2 0
14 16 1 0
15 22 2 0
15 23 1 0
16 17 2 0
16 18 1 0
17 19 1 0
18 20 2 0
19 21 2 0
20 21 1 0
22 26 1 0
23 27 2 0
24 29 1 0
25 30 1 0
26 28 2 0
27 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.95Molecular Weight (Monoisotopic): 494.0914AlogP: 3.69#Rotatable Bonds: 7Polar Surface Area: 100.33Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.60CX LogD: 3.60Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -1.32
References 1. PubChem BioAssay data set,