The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24394848 ID: ALA1604447
PubChem CID: 16016991
Max Phase: Preclinical
Molecular Formula: C21H22F3N5O2
Molecular Weight: 433.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nn(CC(=O)N2CCN(c3cccc(C(F)(F)F)c3)CC2)c(=O)c2cccn12
Standard InChI: InChI=1S/C21H22F3N5O2/c1-2-18-25-29(20(31)17-7-4-8-28(17)18)14-19(30)27-11-9-26(10-12-27)16-6-3-5-15(13-16)21(22,23)24/h3-8,13H,2,9-12,14H2,1H3
Standard InChI Key: VFFMFJNKRJZKTK-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
0.7290 3.7283 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0960 2.9033 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.5540 2.9033 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.9867 0.4283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8433 -1.6342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7012 -1.6342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2723 -0.8092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2723 -1.6342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1288 -0.3967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6999 0.4283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7012 -0.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9867 -0.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9867 -2.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4858 -0.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4858 -1.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5578 -0.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8433 -0.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0146 0.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9707 -1.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7290 2.0783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9867 -2.8717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0146 1.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7290 2.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1288 0.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4144 -0.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4144 0.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6999 -0.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7290 0.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4435 1.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4435 0.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2723 -3.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 23 1 0
2 23 1 0
3 23 1 0
4 12 2 0
5 17 2 0
6 11 1 0
6 13 1 0
6 15 1 0
7 8 1 0
7 12 1 0
7 16 1 0
8 13 2 0
9 17 1 0
9 24 1 0
9 25 1 0
10 18 1 0
10 26 1 0
10 27 1 0
11 12 1 0
11 14 2 0
13 21 1 0
14 19 1 0
15 19 2 0
16 17 1 0
18 22 1 0
18 28 2 0
20 22 2 0
20 23 1 0
20 29 1 0
21 31 1 0
24 26 1 0
25 27 1 0
28 30 1 0
29 30 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.43Molecular Weight (Monoisotopic): 433.1726AlogP: 2.43#Rotatable Bonds: 4Polar Surface Area: 62.85Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.82CX LogP: 2.41CX LogD: 2.41Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.63Np Likeness Score: -2.24
References 1. PubChem BioAssay data set,