The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24394816 ID: ALA1604475
PubChem CID: 16016959
Max Phase: Preclinical
Molecular Formula: C25H24N4O2S
Molecular Weight: 444.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1C(=O)c2ccccc2Sc2ccc(NC(=O)N3CCN(c4ccccc4)CC3)cc21
Standard InChI: InChI=1S/C25H24N4O2S/c1-27-21-17-18(11-12-23(21)32-22-10-6-5-9-20(22)24(27)30)26-25(31)29-15-13-28(14-16-29)19-7-3-2-4-8-19/h2-12,17H,13-16H2,1H3,(H,26,31)
Standard InChI Key: WOYXKJJKMBWEIE-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-2.4640 2.4929 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.2345 -0.0577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0655 2.7708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0515 0.6856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6443 1.4054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0374 1.7233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6141 1.2370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5371 1.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7207 2.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3909 1.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8765 0.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2073 2.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7488 1.0874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1440 1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1160 2.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3276 2.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1793 1.0874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8121 2.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2491 1.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6936 -0.0577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7840 1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6004 2.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6422 2.2845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2210 0.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4025 0.9938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4305 2.0413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0094 0.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0072 1.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5861 0.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7956 1.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3744 -0.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9792 0.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 9 1 0
1 12 1 0
2 11 2 0
3 19 2 0
4 8 1 0
4 11 1 0
4 20 1 0
5 14 1 0
5 19 1 0
6 19 1 0
6 23 1 0
6 24 1 0
7 25 1 0
7 26 1 0
7 27 1 0
8 9 2 0
8 13 1 0
9 15 1 0
10 11 1 0
10 12 2 0
10 17 1 0
12 18 1 0
13 14 2 0
14 16 1 0
15 16 2 0
17 21 2 0
18 22 2 0
21 22 1 0
23 26 1 0
24 27 1 0
25 28 2 0
25 29 1 0
28 30 1 0
29 31 2 0
30 32 2 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.56Molecular Weight (Monoisotopic): 444.1620AlogP: 4.78#Rotatable Bonds: 2Polar Surface Area: 55.89Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.09CX Basic pKa: 3.42CX LogP: 4.23CX LogD: 4.23Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.62Np Likeness Score: -1.72
References 1. PubChem BioAssay data set,