The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID842227 ID: ALA1604479
PubChem CID: 644482
Max Phase: Preclinical
Molecular Formula: C19H25N5O5S2
Molecular Weight: 467.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)CSc1nnc(-c2ccc(S(=O)(=O)N3CCOCC3)cc2)n1CC1CCCO1
Standard InChI: InChI=1S/C19H25N5O5S2/c20-17(25)13-30-19-22-21-18(24(19)12-15-2-1-9-29-15)14-3-5-16(6-4-14)31(26,27)23-7-10-28-11-8-23/h3-6,15H,1-2,7-13H2,(H2,20,25)
Standard InChI Key: ICAVFGNNONZNJW-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-0.1398 2.3908 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1516 -1.7803 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.6918 1.7777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4123 3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8445 -2.3602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9791 4.0469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8923 -3.0972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2264 -0.6378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7529 2.9428 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1196 0.3542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5321 -0.3603 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4946 -3.3943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3126 0.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6995 0.7347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4733 1.8388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9800 -0.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9149 0.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8710 1.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3018 1.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2579 2.0937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5119 -1.0503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5119 -1.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5813 3.7498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5375 2.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1944 4.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1506 3.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1793 -2.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9362 -2.0353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0994 -3.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9244 -3.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1077 -2.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 2 0
1 4 2 0
1 9 1 0
1 15 1 0
2 16 1 0
2 28 1 0
5 22 1 0
5 29 1 0
6 25 1 0
6 26 1 0
7 31 2 0
8 13 1 0
8 16 1 0
8 21 1 0
9 23 1 0
9 24 1 0
10 11 1 0
10 13 2 0
11 16 2 0
12 31 1 0
13 14 1 0
14 17 2 0
14 18 1 0
15 19 2 0
15 20 1 0
17 19 1 0
18 20 2 0
21 22 1 0
22 27 1 0
23 25 1 0
24 26 1 0
27 30 1 0
28 31 1 0
29 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.57Molecular Weight (Monoisotopic): 467.1297AlogP: 0.72#Rotatable Bonds: 8Polar Surface Area: 129.64Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.21CX LogP: 0.07CX LogD: 0.07Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.56Np Likeness Score: -2.35
References 1. PubChem BioAssay data set, 2. PubChem BioAssay data set,